EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H24N6O2 |
| Net Charge | 0 |
| Average Mass | 344.419 |
| Monoisotopic Mass | 344.19607 |
| SMILES | CC(C)OC1CN(c2nc(N)nc3c2ncn3[C@H]2C=C[C@@H](CO)C2)C1 |
| InChI | InChI=1S/C17H24N6O2/c1-10(2)25-13-6-22(7-13)15-14-16(21-17(18)20-15)23(9-19-14)12-4-3-11(5-12)8-24/h3-4,9-13,24H,5-8H2,1-2H3,(H2,18,20,21)/t11-,12+/m1/s1 |
| InChIKey | MALXRGLKOHFCJX-NEPJUHHUSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-de(cyclopropylamino)-6-(3-isopropoxyazetidin-1-yl)abacavir (CHEBI:149432) has functional parent abacavir (CHEBI:421707) |
| 6-de(cyclopropylamino)-6-(3-isopropoxyazetidin-1-yl)abacavir (CHEBI:149432) has role antiviral agent (CHEBI:22587) |
| 6-de(cyclopropylamino)-6-(3-isopropoxyazetidin-1-yl)abacavir (CHEBI:149432) is a 2,6-diaminopurines (CHEBI:38001) |
| IUPAC Name |
|---|
| [(1S,4R)-4-(2-amino-6-{3-[(propan-2-yl)oxy]azetidin-1-yl}-9H-purin-9-yl)cyclopent-2-en-1-yl]methanol |
| Synonym | Source |
|---|---|
| (1S,4R)-4-[2-amino-6-[3-(1-methylethoxy)-1-azetidinyl]-9H-purin-9-yl]-2-cyclopentene-1-methanol | ChEBI |
| Citations |
|---|