EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H18N6O |
| Net Charge | 0 |
| Average Mass | 286.339 |
| Monoisotopic Mass | 286.15421 |
| SMILES | Nc1nc(N2CCC2)c2ncn([C@H]3C=C[C@@H](CO)C3)c2n1 |
| InChI | InChI=1S/C14H18N6O/c15-14-17-12(19-4-1-5-19)11-13(18-14)20(8-16-11)10-3-2-9(6-10)7-21/h2-3,8-10,21H,1,4-7H2,(H2,15,17,18)/t9-,10+/m1/s1 |
| InChIKey | ARAIATBRBSWLHC-ZJUUUORDSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-de(cyclopropylamino)-6-(azetidin-1-yl)abacavir (CHEBI:149431) has functional parent abacavir (CHEBI:421707) |
| 6-de(cyclopropylamino)-6-(azetidin-1-yl)abacavir (CHEBI:149431) has role antiviral agent (CHEBI:22587) |
| 6-de(cyclopropylamino)-6-(azetidin-1-yl)abacavir (CHEBI:149431) is a 2,6-diaminopurines (CHEBI:38001) |
| IUPAC Name |
|---|
| {(1S,4R)-4-[2-amino-6-(azetidin-1-yl)-9H-purin-9-yl]cyclopent-2-en-1-yl}methanol |
| Synonym | Source |
|---|---|
| (1S,4R)-4-[2-amino-6-(1-azetidinyl)-9H-purin-9-yl]-2-cyclopentene-1-methanol | ChEBI |
| Citations |
|---|