EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H22N6O |
| Net Charge | 0 |
| Average Mass | 314.393 |
| Monoisotopic Mass | 314.18551 |
| SMILES | CC1(C)CCN1c1nc(N)nc2c1ncn2[C@H]1C=C[C@@H](CO)C1 |
| InChI | InChI=1S/C16H22N6O/c1-16(2)5-6-22(16)14-12-13(19-15(17)20-14)21(9-18-12)11-4-3-10(7-11)8-23/h3-4,9-11,23H,5-8H2,1-2H3,(H2,17,19,20)/t10-,11+/m1/s1 |
| InChIKey | AZNKZYXEUMQLIU-MNOVXSKESA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-de(cyclopropylamino)-6-(2,2-dimethylazetidin-1-yl)abacavir (CHEBI:149430) has functional parent abacavir (CHEBI:421707) |
| 6-de(cyclopropylamino)-6-(2,2-dimethylazetidin-1-yl)abacavir (CHEBI:149430) has role antiviral agent (CHEBI:22587) |
| 6-de(cyclopropylamino)-6-(2,2-dimethylazetidin-1-yl)abacavir (CHEBI:149430) is a 2,6-diaminopurines (CHEBI:38001) |
| IUPAC Name |
|---|
| {(1S,4R)-4-[2-amino-6-(2,2-dimethylazetidin-1-yl)-9H-purin-9-yl]cyclopent-2-en-1-yl}methanol |
| Synonym | Source |
|---|---|
| (1S,4R)-4-[2-amino-6-(2,2-dimethyl-1-azetidinyl)-9H-purin-9-yl]-2-cyclopentene-1-methanol | ChEBI |
| Citations |
|---|