EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| ChEBI ID | CHEBI:148937 |
| ChEBI Name | β-D-Galp-(1→4)-D-Xylp |
| Stars | |
| ASCII Name | beta-D-Galp-(1->4)-D-Xylp |
| Definition | A disaccharide consisting of a β-D-galactopyranose residue joined to a D-xylopyranose residue by a (1→4) glycosidic bond. Used to diagnose hypolactasia (lactose intolerance as a result of lactase deficiency) via presence of D-xylose after cleavage by lactase. |
| Last Modified | 5 May 2020 |
| Submitter | Gareth Owen |
| Downloads |
| Formula | C11H20O10 |
| Net Charge | 0 |
| Average Mass | 312.271 |
| Monoisotopic Mass | 312.10565 |
| SMILES | OC[C@H]1O[C@@H](O[C@@H]2COC(O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@H]1O |
| WURCS | WURCS=2.0/2,2,1/[a212h-1x_1-5][a2112h-1b_1-5]/1-2/a4-b1 |
| InChI | InChI=1S/C11H20O10/c12-1-3-5(13)7(15)9(17)11(20-3)21-4-2-19-10(18)8(16)6(4)14/h3-18H,1-2H2/t3-,4-,5+,6+,7+,8-,9-,10?,11+/m1/s1 |
| InChIKey | VCTBNHVCBSUQPG-NCRZSTDJSA-N |
| Roles Classification |
|---|
| Application: | diagnostic agent A substance administered to aid diagnosis of a disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| β-D-Galp-(1→4)-D-Xylp (CHEBI:148937) has functional parent D-xylopyranose (CHEBI:53455) |
| β-D-Galp-(1→4)-D-Xylp (CHEBI:148937) has functional parent β-D-galactose (CHEBI:27667) |
| β-D-Galp-(1→4)-D-Xylp (CHEBI:148937) has role diagnostic agent (CHEBI:33295) |
| β-D-Galp-(1→4)-D-Xylp (CHEBI:148937) is a glycosylxylose (CHEBI:35380) |
| Incoming Relation(s) |
| β-D-Galp-(1→3)-β-D-Galp-(1→4)-D-Xylp (CHEBI:146882) has functional parent β-D-Galp-(1→4)-D-Xylp (CHEBI:148937) |
| IUPAC Names |
|---|
| 4-O-β-D-galactopyranosyl-D-xylopyranose |
| Gal(b1-4)Xyl |
| INNs | Source |
|---|---|
| gaxilosa | ChEBI |
| gaxilose | ChEBI |
| gaxilose | ChemIDplus |
| gaxilosum | ChEBI |
| Synonyms | Source |
|---|---|
| (2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-[(3R,4R,5R)-4,5,6-trihydroxyoxan-3-yl]oxyoxane-3,4,5-triol | IUPAC |
| 4-O-galactosyl-D-xylose | ChemIDplus |
| 4-O-galactosylxylose | ChemIDplus |
| β-D-galacto-hexopyranosyl-(1→4)-D-xylo-pentopyranose | IUPAC |