EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H9Cl2NO3 |
| Net Charge | 0 |
| Average Mass | 274.103 |
| Monoisotopic Mass | 272.99595 |
| SMILES | O=C(O)C1(C(=O)Nc2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C11H9Cl2NO3/c12-6-1-2-8(7(13)5-6)14-9(15)11(3-4-11)10(16)17/h1-2,5H,3-4H2,(H,14,15)(H,16,17) |
| InChIKey | GLWWLNJJJCTFMZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | fungicide A substance used to destroy fungal pests. plant growth regulator A chemical, natural or artificial, that can affect the rate of growth of a plant. |
| Application: | fungicide A substance used to destroy fungal pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cyclanilide (CHEBI:148439) has role fungicide (CHEBI:24127) |
| cyclanilide (CHEBI:148439) has role plant growth regulator (CHEBI:26155) |
| cyclanilide (CHEBI:148439) is a anilide (CHEBI:13248) |
| cyclanilide (CHEBI:148439) is a cyclopropanes (CHEBI:51454) |
| cyclanilide (CHEBI:148439) is a dichlorobenzene (CHEBI:23697) |
| cyclanilide (CHEBI:148439) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| 1-[(2,4-dichlorophenyl)carbamoyl]cyclopropanecarboxylic acid |
| Synonyms | Source |
|---|---|
| 1-[(2,4-dichloroanilino)carbonyl]cyclopropanecarboxylic acid | Alan Wood's Pesticides |
| 1-[(2,4-dichlorophenyl)aminocarbonyl]-1-cyclopropanecarboxylic acid | ChEBI |
| 1-[[(2,4-dichlorophenyl)amino]carbonyl]cyclopropanecarboxylic acid | Alan Wood's Pesticides |
| 1-[(2,4-dichlorophenyl)carbamoyl]cyclopropane-1-carboxylic acid | IUPAC |
| Brand Names | Source |
|---|---|
| Finish | ChemIDplus |
| RPA 90946 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 187 | PPDB |
| cyclanilide | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| CAS:113136-77-9 | ChemIDplus |
| Citations |
|---|