EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H8N2.H3O4P |
| Net Charge | 0 |
| Average Mass | 194.127 |
| Monoisotopic Mass | 194.04564 |
| SMILES | Cc1cnnc1C.O=P(O)(O)O |
| InChI | InChI=1S/C5H8N2.H3O4P/c1-4-3-6-7-5(4)2;1-5(2,3)4/h3H,1-2H3,(H,6,7);(H3,1,2,3,4) |
| InChIKey | LXKCHCXZBPLTAE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | nitrification inhibitor Any inhibitor added to nitrogen fertilizers which can reduce the rate at which ammonium is converted to nitrate. Under appropriate conditions, this can help reduce nitrogen losses through denitrification and leaching. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,4-dimethyl-1H-pyrazole phosphate (CHEBI:148435) has part 3,4-dimethyl-1H-pyrazole (CHEBI:148437) |
| 3,4-dimethyl-1H-pyrazole phosphate (CHEBI:148435) has role nitrification inhibitor (CHEBI:148436) |
| 3,4-dimethyl-1H-pyrazole phosphate (CHEBI:148435) is a phosphate salt (CHEBI:37853) |
| IUPAC Name |
|---|
| 3,4-dimethyl-1H-pyrazole phosphate |
| Synonyms | Source |
|---|---|
| 3,4-dimethyl-1H-pyrazole monophosphate | ChEBI |
| 3,4-dimethylpyrazole phosphate | ChEBI |
| 3,4-DMPP | ChEBI |
| DMPP | ChEBI |
| Brand Name | Source |
|---|---|
| Entec | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:14555408 | Reaxys |
| CAS:202842-98-6 | ChEBI |
| Citations |
|---|