EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12O6 |
| Net Charge | 0 |
| Average Mass | 180.156 |
| Monoisotopic Mass | 180.06339 |
| SMILES | OC[C@H](O)[C@@H]1OC(O)[C@H](O)[C@H]1O |
| WURCS | WURCS=2.0/1,1,0/[a2111h-1x_1-4]/1/ |
| InChI | InChI=1S/C6H12O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2-11H,1H2/t2-,3+,4+,5-,6?/m0/s1 |
| InChIKey | AVVWPBAENSWJCB-DHVFOXMCSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-altrofuranose (CHEBI:148061) is a L-altrose (CHEBI:149543) |
| L-altrofuranose (CHEBI:148061) is enantiomer of D-altrofuranose (CHEBI:152558) |
| Incoming Relation(s) |
| α-L-altrofuranose (CHEBI:150666) is a L-altrofuranose (CHEBI:148061) |
| β-L-altrofuranose (CHEBI:150524) is a L-altrofuranose (CHEBI:148061) |
| D-altrofuranose (CHEBI:152558) is enantiomer of L-altrofuranose (CHEBI:148061) |
| IUPAC Names |
|---|
| Altf |
| L-altrofuranose |
| Synonyms | Source |
|---|---|
| (3R,4R,5S)-5-[(1S)-1,2-dihydroxyethyl]oxolane-2,3,4-triol | IUPAC |
| L-altro-hexofuranose | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| G18982ND | GlyTouCan |