EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H11IN2O5 |
| Net Charge | 0 |
| Average Mass | 354.100 |
| Monoisotopic Mass | 353.97127 |
| SMILES | O=c1nc(=O)n([C@H]2C[C@H](O)[C@@H](CO)O2)cc1I |
| InChI | InChI=1S/C9H11IN2O5/c10-4-2-12(9(16)11-8(4)15)7-1-5(14)6(3-13)17-7/h2,5-7,13-14H,1,3H2,(H,11,15,16)/t5-,6+,7+/m0/s1 |
| InChIKey | XQFRJNBWHJMXHO-RRKCRQDMSA-N |
| Roles Classification |
|---|
| Biological Roles: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. DNA synthesis inhibitor Any substance that inhibits the synthesis of DNA. |
| Application: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-iodo-2'-deoxyuridine (CHEBI:147675) has role antiviral drug (CHEBI:36044) |
| 5-iodo-2'-deoxyuridine (CHEBI:147675) has role DNA synthesis inhibitor (CHEBI:59517) |
| 5-iodo-2'-deoxyuridine (CHEBI:147675) is a organoiodine compound (CHEBI:37142) |
| 5-iodo-2'-deoxyuridine (CHEBI:147675) is a pyrimidine 2'-deoxyribonucleoside (CHEBI:19255) |
| IUPAC Name |
|---|
| 2'-deoxy-5-iodouridine |
| INNs | Source |
|---|---|
| idoxuridina | ChemIDplus |
| idoxuridine | WHO MedNet |
| idoxuridine | ChemIDplus |
| Idoxuridinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1-(2-Deoxy-beta-D-ribofuranosyl)-5-iodouracil | ChemIDplus |
| 1-beta-D-2'-Deoxyribofuranosyl-5-iodouracil | ChemIDplus |
| 1beta-D-2'-Deoxyribofuranosyl-5-iodouracil | ChemIDplus |
| 2'-Deoxy-5-iodouridine | ChemIDplus |
| (+)-5-Iodo-2'-deoxyuridine | NIST Chemistry WebBook |
| 5-Iododeoxyuridine | DrugBank |
| Citations |
|---|