EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H27N3O15S |
| Net Charge | 0 |
| Average Mass | 617.542 |
| Monoisotopic Mass | 617.11629 |
| SMILES | NC(CCC(=O)NC(CSc1cc(/C=C/C(=O)OC(C(=O)O)C(O)C(=O)O)cc(O)c1O)C(=O)NCC(=O)O)C(=O)O |
| InChI | InChI=1S/C23H27N3O15S/c24-10(21(35)36)2-3-14(28)26-11(20(34)25-7-15(29)30)8-42-13-6-9(5-12(27)17(13)32)1-4-16(31)41-19(23(39)40)18(33)22(37)38/h1,4-6,10-11,18-19,27,32-33H,2-3,7-8,24H2,(H,25,34)(H,26,28)(H,29,30)(H,35,36)(H,37,38)(H,39,40)/b4-1+ |
| InChIKey | GYXGDEQYOIGEEQ-DAFODLJHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Vitis vinifera (ncbitaxon:29760) | Wine (NCIT:C66822) | PubMed (24097399) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glutathionyl-caftaric acid (CHEBI:147433) is a oligopeptide (CHEBI:25676) |