EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H17N3O9S2 |
| Net Charge | 0 |
| Average Mass | 387.392 |
| Monoisotopic Mass | 387.04062 |
| SMILES | N[C@@H](CCC(=O)N(CC(=O)O)C(=O)[C@@H](N)CSS(=O)(=O)O)C(=O)O |
| InChI | InChI=1S/C10H17N3O9S2/c11-5(10(18)19)1-2-7(14)13(3-8(15)16)9(17)6(12)4-23-24(20,21)22/h5-6H,1-4,11-12H2,(H,15,16)(H,18,19)(H,20,21,22)/t5-,6-/m0/s1 |
| InChIKey | HBEFTXHFDQJRJD-WDSKDSINSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Vitis vinifera (ncbitaxon:29760) | Wine (NCIT:C66822) | PubMed (26709023) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glutathione sulfonate (CHEBI:147425) is a S-substituted glutathione (CHEBI:17021) |
| glutathione sulfonate (CHEBI:147425) is a L-cysteine derivative (CHEBI:83824) |
| glutathione sulfonate (CHEBI:147425) is a tripeptide (CHEBI:47923) |