EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12FN3O4 |
| Net Charge | 0 |
| Average Mass | 257.221 |
| Monoisotopic Mass | 257.08118 |
| SMILES | Nc1ccn([C@@H]2C(F)=C(CO)[C@@H](O)[C@H]2O)c(=O)n1 |
| InChI | InChI=1S/C10H12FN3O4/c11-6-4(3-15)8(16)9(17)7(6)14-2-1-5(12)13-10(14)18/h1-2,7-9,15-17H,3H2,(H2,12,13,18)/t7-,8-,9+/m1/s1 |
| InChIKey | QLLGKCJUPWYJON-HLTSFMKQSA-N |
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. DNA synthesis inhibitor Any substance that inhibits the synthesis of DNA. antimetabolite A substance which is structurally similar to a metabolite but which competes with it or replaces it, and so prevents or reduces its normal utilization. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| roducitabine (CHEBI:147412) has role antimetabolite (CHEBI:35221) |
| roducitabine (CHEBI:147412) has role antineoplastic agent (CHEBI:35610) |
| roducitabine (CHEBI:147412) has role apoptosis inducer (CHEBI:68495) |
| roducitabine (CHEBI:147412) has role DNA synthesis inhibitor (CHEBI:59517) |
| roducitabine (CHEBI:147412) has role prodrug (CHEBI:50266) |
| roducitabine (CHEBI:147412) is a organofluorine compound (CHEBI:37143) |
| roducitabine (CHEBI:147412) is a primary allylic alcohol (CHEBI:134394) |
| roducitabine (CHEBI:147412) is a triol (CHEBI:27136) |
| IUPAC Name |
|---|
| 4-amino-1-[(1S,4R,5S)-2-fluoro-4,5-dihydroxy-3-(hydroxymethyl)cyclopent-2-en-1-yl]pyrimidin-2(1H)-one |
| Synonyms | Source |
|---|---|
| RX-3117 | ChemIDplus |
| fluorocyclopentenylcytosine | ChEBI |
| TV-1360 | ChEBI |
| fluorocyclopentenyl-cytosine | ChEBI |
| fluorocyclopentenyl cytosine | ChEBI |
| RX3117 | ChemIDplus |
| UniProt Name | Source |
|---|---|
| fluorocyclopentenylcytosine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| D11740 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:865838-26-2 | ChemIDplus |
| Citations |
|---|