EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12FN3O4 |
| Net Charge | 0 |
| Average Mass | 257.221 |
| Monoisotopic Mass | 257.08118 |
| SMILES | Nc1ccn([C@@H]2C(F)=C(CO)[C@@H](O)[C@H]2O)c(=O)n1 |
| InChI | InChI=1S/C10H12FN3O4/c11-6-4(3-15)8(16)9(17)7(6)14-2-1-5(12)13-10(14)18/h1-2,7-9,15-17H,3H2,(H2,12,13,18)/t7-,8-,9+/m1/s1 |
| InChIKey | QLLGKCJUPWYJON-HLTSFMKQSA-N |
| Roles Classification |
|---|
| Biological Roles: | antimetabolite A substance which is structurally similar to a metabolite but which competes with it or replaces it, and so prevents or reduces its normal utilization. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. DNA synthesis inhibitor Any substance that inhibits the synthesis of DNA. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| roducitabine (CHEBI:147412) has role antimetabolite (CHEBI:35221) |
| roducitabine (CHEBI:147412) has role antineoplastic agent (CHEBI:35610) |
| roducitabine (CHEBI:147412) has role apoptosis inducer (CHEBI:68495) |
| roducitabine (CHEBI:147412) has role DNA synthesis inhibitor (CHEBI:59517) |
| roducitabine (CHEBI:147412) has role prodrug (CHEBI:50266) |
| roducitabine (CHEBI:147412) is a organofluorine compound (CHEBI:37143) |
| roducitabine (CHEBI:147412) is a primary allylic alcohol (CHEBI:134394) |
| roducitabine (CHEBI:147412) is a triol (CHEBI:27136) |
| IUPAC Name |
|---|
| 4-amino-1-[(1S,4R,5S)-2-fluoro-4,5-dihydroxy-3-(hydroxymethyl)cyclopent-2-en-1-yl]pyrimidin-2(1H)-one |
| Synonyms | Source |
|---|---|
| 1-[(1S,4R,5S)-2-fluoro-3-(hydroxymethyl)-4,5-dihydroxy-2-cyclopentenyl]cytosine | ChEBI |
| 4-amino-1-[(1S,4R,5S)-2-fluoro-4,5-dihydroxy-3-(hydroxymethyl)cyclopent-2-en-1-yl]-1,2-dihydropyrimidin-2-one | ChEBI |
| fluorocyclopentenyl cytosine | ChEBI |
| fluorocyclopentenyl-cytosine | ChEBI |
| fluorocyclopentenylcytosine | ChEBI |
| RX 3117 | ChemIDplus |
| UniProt Name | Source |
|---|---|
| fluorocyclopentenylcytosine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| D11740 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:865838-26-2 | ChemIDplus |
| Citations |
|---|