EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10N2O2S |
| Net Charge | 0 |
| Average Mass | 222.269 |
| Monoisotopic Mass | 222.04630 |
| SMILES | Cn1sc(=O)n(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C10H10N2O2S/c1-11-9(13)12(10(14)15-11)7-8-5-3-2-4-6-8/h2-6H,7H2,1H3 |
| InChIKey | JDSJDASOXWCHPN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. EC 2.7.11.26 (tau-protein kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of tau-protein kinase inhibitor (EC 2.7.11.26). |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| TDZD-8 (CHEBI:147411) has role anti-inflammatory agent (CHEBI:67079) |
| TDZD-8 (CHEBI:147411) has role antineoplastic agent (CHEBI:35610) |
| TDZD-8 (CHEBI:147411) has role apoptosis inducer (CHEBI:68495) |
| TDZD-8 (CHEBI:147411) has role EC 2.7.11.26 (tau-protein kinase) inhibitor (CHEBI:91092) |
| TDZD-8 (CHEBI:147411) has role neuroprotective agent (CHEBI:63726) |
| TDZD-8 (CHEBI:147411) is a benzenes (CHEBI:22712) |
| TDZD-8 (CHEBI:147411) is a thiadiazolidine (CHEBI:48865) |
| IUPAC Name |
|---|
| 4-benzyl-2-methyl-1,2,4-thiadiazolidine-3,5-dione |
| Synonyms | Source |
|---|---|
| NP 01139 | ChEBI |
| thiadiazolidinone-8 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| NZ574619 | Patent |
| Registry Numbers | Sources |
|---|---|
| CAS:327036-89-5 | SUBMITTER |
| Citations |
|---|