EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | 2H4N.O3S2 |
| Net Charge | 0 |
| Average Mass | 148.209 |
| Monoisotopic Mass | 147.99763 |
| SMILES | O=S(=O)([O-])[S-].[NH4+].[NH4+] |
| InChI | InChI=1S/2H3N.H2O3S2/c;;1-5(2,3)4/h2*1H3;(H2,1,2,3,4) |
| InChIKey | XYXNTHIYBIDHGM-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | reducing agent The element or compound in a reduction-oxidation (redox) reaction that donates an electron to another species. |
| Applications: | herbicide safener A compound used with herbicides that reduces the effect of the herbicide on crop plants or otherwise improves the selectivity of the herbicide for weed species over the crop plant. fertilizer A fertilizer is any substance that is added to soil or water to assist the growth of plants. bleaching agent A reagent that lightens or whitens a substrate through chemical reaction. Bleaching reactions usually involve oxidative or reductive processes that degrade colour systems. Bleaching can occur by destroying one or more of the double bonds in the conjugated chain, by cleaving the conjugated chain, or by oxidation of one of the other moieties in the conjugated chain. Their reactivity results in many bleaches having strong bactericidal, disinfecting, and sterilising properties. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ammonium thiosulfate (CHEBI:147402) has part thiosulfate(2−) (CHEBI:16094) |
| ammonium thiosulfate (CHEBI:147402) has role bleaching agent (CHEBI:132717) |
| ammonium thiosulfate (CHEBI:147402) has role fertilizer (CHEBI:33287) |
| ammonium thiosulfate (CHEBI:147402) has role herbicide safener (CHEBI:132272) |
| ammonium thiosulfate (CHEBI:147402) has role reducing agent (CHEBI:63247) |
| ammonium thiosulfate (CHEBI:147402) is a inorganic ammonium salt (CHEBI:147406) |
| IUPAC Name |
|---|
| diammonium sulfurothioate |
| Synonyms | Source |
|---|---|
| ammo hypo | ChemIDplus |
| ammonium hyposulfite | ChemIDplus |
| ammonium thiosulfate | ChemIDplus |
| ammonium thiosulphate | ChemIDplus |
| ATS | ChEBI |
| bisammonium sulfurothioate | IUPAC |
| Brand Name | Source |
|---|---|
| Thio-Sul | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Ammonium_thiosulfate | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:7783-18-8 | ChemIDplus |
| Citations |
|---|