EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H10N3O9P |
| Net Charge | -2 |
| Average Mass | 323.154 |
| Monoisotopic Mass | 323.01656 |
| SMILES | O=c1cnn([C@@H]2O[C@H](COP(=O)([O-])[O-])[C@@H](O)[C@H]2O)c(=O)n1 |
| InChI | InChI=1S/C8H12N3O9P/c12-4-1-9-11(8(15)10-4)7-6(14)5(13)3(20-7)2-19-21(16,17)18/h1,3,5-7,13-14H,2H2,(H,10,12,15)(H2,16,17,18)/p-2/t3-,5-,6-,7-/m1/s1 |
| InChIKey | LRVZOSYMNMNQFR-SHUUEZRQSA-L |
| Roles Classification |
|---|
| Biological Role: | EC 4.1.1.23 (orotidine-5'-phosphate decarboxylase) inhibitor Any EC 4.1.1.* (carboxy-lyase) inhibitor that interferes with the action of orotidine-5'-phosphate decarboxylase (EC 4.1.1.23). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-azauridine 5'-monophosphate(2−) (CHEBI:147401) has role antineoplastic agent (CHEBI:35610) |
| 6-azauridine 5'-monophosphate(2−) (CHEBI:147401) has role EC 4.1.1.23 (orotidine-5'-phosphate decarboxylase) inhibitor (CHEBI:90285) |
| 6-azauridine 5'-monophosphate(2−) (CHEBI:147401) is a organophosphate oxoanion (CHEBI:58945) |
| 6-azauridine 5'-monophosphate(2−) (CHEBI:147401) is conjugate base of 6-azauridine 5'-monophosphate (CHEBI:46319) |
| Incoming Relation(s) |
| 6-azauridine 5'-monophosphate (CHEBI:46319) is conjugate acid of 6-azauridine 5'-monophosphate(2−) (CHEBI:147401) |
| IUPAC Name |
|---|
| 2-(5-O-phosphonato-β-D-ribofuranosyl)-1,2,4-triazine-3,5(2H,4H)-dione |
| Synonyms | Source |
|---|---|
| [(2R,3S,4R,5R)-5-(3,5-dioxo-4,5-dihydro-1,2,4-triazin-2(3H)-yl)-3,4-dihydroxytetrahydrofuran-2-yl]methyl phosphate | IUPAC |
| 6-aza UMP(2−) | ChEBI |
| UniProt Name | Source |
|---|---|
| 6-azauridine 5'-phosphate | UniProt |
| Citations |
|---|