EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H19BrO2 |
| Net Charge | 0 |
| Average Mass | 299.208 |
| Monoisotopic Mass | 298.05684 |
| SMILES | C=C1C[C@@H](O)[C@@H](Br)C(C)(C)[C@@]12C=CC(=O)CC2 |
| InChI | InChI=1S/C14H19BrO2/c1-9-8-11(17)12(15)13(2,3)14(9)6-4-10(16)5-7-14/h4,6,11-12,17H,1,5,7-8H2,2-3H3/t11-,12-,14-/m1/s1 |
| InChIKey | ZERRJERBGYWIKI-YRGRVCCFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Laurencia scoparia (ncbitaxon:288677) | - | PubMed (11250580) |
| Roles Classification |
|---|
| Biological Roles: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ma'ilione (CHEBI:147400) has role algal metabolite (CHEBI:84735) |
| ma'ilione (CHEBI:147400) has role marine metabolite (CHEBI:76507) |
| ma'ilione (CHEBI:147400) is a olefinic compound (CHEBI:78840) |
| ma'ilione (CHEBI:147400) is a organobromine compound (CHEBI:37141) |
| ma'ilione (CHEBI:147400) is a secondary alcohol (CHEBI:35681) |
| ma'ilione (CHEBI:147400) is a sesquiterpenoid (CHEBI:26658) |
| ma'ilione (CHEBI:147400) is a spiro compound (CHEBI:33599) |
| IUPAC Name |
|---|
| (6S,8S,9R)-8-bromo-9-hydroxy-7,7-dimethyl-11-methylidenespiro[5.5]undec-1-en-3-one |
| Synonyms | Source |
|---|---|
| 10-bromo-9-hydroxy-15-nor-1,7(14)-chamigradien-3-one | ChEBI |
| 8-bromo-9-hydroxy-7,7-dimethyl-11-methylenespiro[5.5]undec-1-en-3-one | SUBMITTER |
| mailione | ChEBI |
| UniProt Name | Source |
|---|---|
| ma'ilione | UniProt |
| Registry Numbers | Sources |
|---|---|
| CAS:185213-74-5 | ChEBI |
| Citations |
|---|