EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:147399 - (+)-halomon
| Formula | C10H15Br2Cl3 |
| Net Charge | 0 |
| Average Mass | 401.397 |
| Monoisotopic Mass | 397.86061 |
| SMILES | C=C(Cl)[C@](Cl)(CBr)CC[C@@H](Br)C(C)(C)Cl |
| InChI | InChI=1S/C10H15Br2Cl3/c1-7(13)10(15,6-11)5-4-8(12)9(2,3)14/h8H,1,4-6H2,2-3H3/t8-,10-/m1/s1 |
| InChIKey | OVLCIYBVQSJPKK-PSASIEDQSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Portieria hornemanii (ncbitaxon:128534) | - | PubMed (1501227) |
| Roles Classification |
|---|
| Biological Roles: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-halomon (CHEBI:147399) has role algal metabolite (CHEBI:84735) |
| (+)-halomon (CHEBI:147399) has role antineoplastic agent (CHEBI:35610) |
| (+)-halomon (CHEBI:147399) has role marine metabolite (CHEBI:76507) |
| (+)-halomon (CHEBI:147399) is a monoterpenoid (CHEBI:25409) |
| (+)-halomon (CHEBI:147399) is a organobromine compound (CHEBI:37141) |
| (+)-halomon (CHEBI:147399) is a organochlorine compound (CHEBI:36683) |
| IUPAC Name |
|---|
| (3S,6R)-6-bromo-3-(bromomethyl)-2,3,7-trichloro-7-methyloct-1-ene |
| Synonyms | Source |
|---|---|
| (+)-6-bromo-3-bromomethyl-2,3,7-trichloro-7-methyl-1-octene | SUBMITTER |
| 6(R)-bromo-3(S)-(bromomethyl)-7-methyl-2,3,7-trichloro-l-octene | ChEBI |
| halomon | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| (+)-halomon | UniProt |
| Registry Numbers | Sources |
|---|---|
| CAS:142439-86-9 | ChemIDplus |
| Citations |
|---|