EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H14N2O2S |
| Net Charge | 0 |
| Average Mass | 334.400 |
| Monoisotopic Mass | 334.07760 |
| SMILES | O=c1sn(-c2cccc3ccccc23)c(=O)n1Cc1ccccc1 |
| InChI | InChI=1S/C19H14N2O2S/c22-18-20(13-14-7-2-1-3-8-14)19(23)24-21(18)17-12-6-10-15-9-4-5-11-16(15)17/h1-12H,13H2 |
| InChIKey | PMJIHLSCWIDGMD-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | EC 2.7.11.26 (tau-protein kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of tau-protein kinase inhibitor (EC 2.7.11.26). apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tideglusib (CHEBI:147398) has role anti-inflammatory agent (CHEBI:67079) |
| tideglusib (CHEBI:147398) has role apoptosis inducer (CHEBI:68495) |
| tideglusib (CHEBI:147398) has role EC 2.7.11.26 (tau-protein kinase) inhibitor (CHEBI:91092) |
| tideglusib (CHEBI:147398) has role neuroprotective agent (CHEBI:63726) |
| tideglusib (CHEBI:147398) is a benzenes (CHEBI:22712) |
| tideglusib (CHEBI:147398) is a naphthalenes (CHEBI:25477) |
| tideglusib (CHEBI:147398) is a thiadiazolidine (CHEBI:48865) |
| IUPAC Name |
|---|
| 4-benzyl-2-(naphthalen-1-yl)-1,2,4-thiadiazolidine-3,5-dione |
| INNs | Source |
|---|---|
| tideglusib | WHO MedNet |
| tideglusib | WHO MedNet |
| tideglusibum | WHO MedNet |
| tidéglusib | WHO MedNet |
| Synonyms | Source |
|---|---|
| NP-031112 | DrugBank |
| NP031112 | DrugBank |
| NP-12 | DrugBank |
| NP 031112 | ChemIDplus |
| Brand Names | Source |
|---|---|
| Zentylor | ChEBI |
| Nypta | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| DB12129 | DrugBank |
| Tideglusib | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:865854-05-3 | ChemIDplus |
| Citations |
|---|