EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H17N3O3 |
| Net Charge | 0 |
| Average Mass | 311.341 |
| Monoisotopic Mass | 311.12699 |
| SMILES | CC(C)[C@]1(C)N=C(c2nc3ccccc3cc2C(=O)O)NC1=O |
| InChI | InChI=1S/C17H17N3O3/c1-9(2)17(3)16(23)19-14(20-17)13-11(15(21)22)8-10-6-4-5-7-12(10)18-13/h4-9H,1-3H3,(H,21,22)(H,19,20,23)/t17-/m0/s1 |
| InChIKey | CABMTIJINOIHOD-KRWDZBQOSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-imazaquin (CHEBI:147360) is a 2-[4-methyl-5-oxo-4-(propan-2-yl)-4,5-dihydro-1H-imidazol-2-yl]quinoline-3-carboxylic acid (CHEBI:147361) |
| (S)-imazaquin (CHEBI:147360) is conjugate acid of (S)-imazaquin(1−) (CHEBI:147374) |
| (S)-imazaquin (CHEBI:147360) is enantiomer of (R)-imazaquin (CHEBI:147359) |
| Incoming Relation(s) |
| imazaquin (CHEBI:5869) has part (S)-imazaquin (CHEBI:147360) |
| (S)-imazaquin(1−) (CHEBI:147374) is conjugate base of (S)-imazaquin (CHEBI:147360) |
| (R)-imazaquin (CHEBI:147359) is enantiomer of (S)-imazaquin (CHEBI:147360) |
| IUPAC Name |
|---|
| 2-[(4S)-4-methyl-5-oxo-4-(propan-2-yl)-4,5-dihydro-1H-imidazol-2-yl]quinoline-3-carboxylic acid |
| Synonym | Source |
|---|---|
| S-imazaquin | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:355841-30-4 | ChEBI |