EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H13Cl2NO2 |
| Net Charge | 0 |
| Average Mass | 226.103 |
| Monoisotopic Mass | 225.03233 |
| SMILES | CC1CN(C(=O)C(Cl)Cl)C(C)(C)O1 |
| InChI | InChI=1S/C8H13Cl2NO2/c1-5-4-11(7(12)6(9)10)8(2,3)13-5/h5-6H,4H2,1-3H3 |
| InChIKey | YNQSILKYZQZHFJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | herbicide safener A compound used with herbicides that reduces the effect of the herbicide on crop plants or otherwise improves the selectivity of the herbicide for weed species over the crop plant. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| R-29148 (CHEBI:147358) has role herbicide safener (CHEBI:132272) |
| R-29148 (CHEBI:147358) is a organochlorine compound (CHEBI:36683) |
| R-29148 (CHEBI:147358) is a oxazolidines (CHEBI:38329) |
| R-29148 (CHEBI:147358) is a tertiary carboxamide (CHEBI:140326) |
| IUPAC Name |
|---|
| 2,2-dichloro-1-(2,2,5-trimethyl-1,3-oxazolidin-3-yl)ethanone |
| Synonyms | Source |
|---|---|
| 2,2,5-trimethyl-3-dichloroacetyl-1,3-oxazolidine | ChemIDplus |
| 2,2,5-trimethyl-3-(dichloroacetyl)-1,3-oxazolidine | ChemIDplus |
| 2,2,5-trimethyl-3-dichloroacetyl oxazolidine | ChEBI |
| 2,2,5-trimethyl-3-(dichloroacetyl)oxazolidine | ChEBI |
| 2,2-dichloro-1-(2,2,5-trimethyl-1,3-oxazolidin-3-yl)ethan-1-one | IUPAC |
| 2,2-dichloro-1-(2,2,5-trimethyl-3-oxazolidinyl)ethanone | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1211976 | Reaxys |
| CAS:52836-31-4 | ChemIDplus |
| Citations |
|---|