EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H46N4O8 |
| Net Charge | 0 |
| Average Mass | 650.773 |
| Monoisotopic Mass | 650.33156 |
| SMILES | CCOC(=O)/C=C/[C@H](C[C@@H]1CCNC1=O)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](COC(C)(C)C)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C35H46N4O8/c1-5-45-30(40)17-16-27(21-26-18-19-36-31(26)41)37-32(42)28(20-24-12-8-6-9-13-24)38-33(43)29(23-47-35(2,3)4)39-34(44)46-22-25-14-10-7-11-15-25/h6-17,26-29H,5,18-23H2,1-4H3,(H,36,41)(H,37,42)(H,38,43)(H,39,44)/b17-16+/t26-,27+,28-,29-/m0/s1 |
| InChIKey | CTAXDRJNQQBEIB-VCJIVHKYSA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 3.4.22.69 (SARS coronavirus main proteinase) inhibitor An EC 3.4.22.* (cysteine endopeptidase) inhibitor that interferes with the action of SARS coronavirus main proteinase (EC 3.4.22.69). anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| SG85 (CHEBI:147346) has role anticoronaviral agent (CHEBI:149553) |
| SG85 (CHEBI:147346) has role antiviral agent (CHEBI:22587) |
| SG85 (CHEBI:147346) has role EC 3.4.22.69 (SARS coronavirus main proteinase) inhibitor (CHEBI:147285) |
| SG85 (CHEBI:147346) is a L-phenylalanine derivative (CHEBI:84144) |
| SG85 (CHEBI:147346) is a L-serine derivative (CHEBI:84135) |
| SG85 (CHEBI:147346) is a benzyl ester (CHEBI:90628) |
| SG85 (CHEBI:147346) is a enoate ester (CHEBI:51702) |
| SG85 (CHEBI:147346) is a ether (CHEBI:25698) |
| SG85 (CHEBI:147346) is a ethyl ester (CHEBI:23990) |
| SG85 (CHEBI:147346) is a pyrrolidin-2-ones (CHEBI:74223) |
| SG85 (CHEBI:147346) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| N-[(benzyloxy)carbonyl]-O-tert-butyl-L-seryl-N-{(2S,3E)-5-ethoxy-5-oxo-1-[(3S)-2-oxopyrrolidin-3-yl]pent-3-en-2-yl}-L-phenylalaninamide |
| Synonyms | Source |
|---|---|
| SG 85 | ChEBI |
| SG-85 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:1575662-24-6 | ChEBI |
| Citations |
|---|