EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H14O3 |
| Net Charge | 0 |
| Average Mass | 194.230 |
| Monoisotopic Mass | 194.09429 |
| SMILES | C/C=C(\C)c1oc(=O)c(C)c(O)c1C |
| InChI | InChI=1S/C11H14O3/c1-5-6(2)10-7(3)9(12)8(4)11(13)14-10/h5,12H,1-4H3/b6-5+ |
| InChIKey | FBHONFXHWOMMPP-AATRIKPKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus fumigatus (ncbitaxon:746128) | - | PubMed (32083553) | Strain: ATCC 46645 |
| Roles Classification |
|---|
| Biological Role: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fumigermin (CHEBI:147341) has role Aspergillus metabolite (CHEBI:76956) |
| fumigermin (CHEBI:147341) is a nectriapyrones (CHEBI:142638) |
| fumigermin (CHEBI:147341) is a organic hydroxy compound (CHEBI:33822) |
| IUPAC Name |
|---|
| 6-[(2E)-but-2-en-2-yl]-4-hydroxy-3,5-dimethyl-2H-pyran-2-one |
| UniProt Name | Source |
|---|---|
| fumigermin | UniProt |
| Citations |
|---|