EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H12O |
| Net Charge | 0 |
| Average Mass | 136.194 |
| Monoisotopic Mass | 136.08882 |
| SMILES | CCCc1ccccc1O |
| InChI | InChI=1S/C9H12O/c1-2-5-8-6-3-4-7-9(8)10/h3-4,6-7,10H,2,5H2,1H3 |
| InChIKey | LCHYEKKJCUJAKN-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Wollemia nobilis (ncbitaxon:56998) | leaf (BTO:0000713) | DOI (10.1016/j.agee.2009.08.009) |
| Roles Classification |
|---|
| Chemical Role: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Application: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-propylphenol (CHEBI:147331) has role flavouring agent (CHEBI:35617) |
| 2-propylphenol (CHEBI:147331) has role plant metabolite (CHEBI:76924) |
| 2-propylphenol (CHEBI:147331) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 2-propylphenol |
| Synonyms | Source |
|---|---|
| 1-(2-hydroxyphenyl)propane | ChemIDplus |
| 1-hydroxy-2-n-propylbenzene | ChemIDplus |
| 1-hydroxy-2-propylbenzene | SUBMITTER |
| 2-n-propylphenol | ChemIDplus |
| o-propylphenol | ChemIDplus |
| UniProt Name | Source |
|---|---|
| 2-propylphenol | UniProt |
| Citations |
|---|