EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:147307 - CMP-(2-aminoethyl)phosphonate(1−)
| Formula | C11H19N4O10P2 |
| Net Charge | -1 |
| Average Mass | 429.239 |
| Monoisotopic Mass | 429.05819 |
| SMILES | Nc1ccn([C@@H]2O[C@H](COP(=O)([O-])OP(=O)([O-])CC[NH3+])[C@@H](O)[C@H]2O)c(=O)n1 |
| InChI | InChI=1S/C11H20N4O10P2/c12-2-4-26(19,20)25-27(21,22)23-5-6-8(16)9(17)10(24-6)15-3-1-7(13)14-11(15)18/h1,3,6,8-10,16-17H,2,4-5,12H2,(H,19,20)(H,21,22)(H2,13,14,18)/p-1/t6-,8-,9-,10-/m1/s1 |
| InChIKey | FBADRUOBFLBKJQ-PEBGCTIMSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| CMP-(2-aminoethyl)phosphonate(1−) (CHEBI:147307) is a organophosphate oxoanion (CHEBI:58945) |
| CMP-(2-aminoethyl)phosphonate(1−) (CHEBI:147307) is conjugate base of CMP-2-aminoethylphosphonate (CHEBI:3276) |
| Incoming Relation(s) |
| CMP-2-aminoethylphosphonate (CHEBI:3276) is conjugate acid of CMP-(2-aminoethyl)phosphonate(1−) (CHEBI:147307) |
| UniProt Name | Source |
|---|---|
| CMP-(2-aminoethyl)phosphonate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-23218 | MetaCyc |
| Citations |
|---|