EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H28O17 |
| Net Charge | 0 |
| Average Mass | 696.570 |
| Monoisotopic Mass | 696.13265 |
| SMILES | O=C(O)[C@](O)(C(=O)/C=C/c1ccc(O)c(O)c1)[C@@H](O)[C@](O)(C(=O)/C=C/c1ccc(O)c(O)c1)[C@](O)(C(=O)O)C(=O)/C=C/c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C33H28O17/c34-19-7-1-16(13-22(19)37)4-10-25(40)31(48,29(44)45)28(43)32(49,26(41)11-5-17-2-8-20(35)23(38)14-17)33(50,30(46)47)27(42)12-6-18-3-9-21(36)24(39)15-18/h1-15,28,34-39,43,48-50H,(H,44,45)(H,46,47)/b10-4+,11-5+,12-6+/t28-,31+,32-,33-/m1/s1 |
| InChIKey | VMAVVUMWBGQKDI-IHQARNGASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Espeletia (ncbitaxon:185152) | leaf (BTO:0000713) | MetaboLights (MTBLS933) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,3,5-tricaffeoylaltraric acid (CHEBI:147305) is a triicaffeoylaltraric acid (CHEBI:147325) |