EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H30O4 |
| Net Charge | 0 |
| Average Mass | 322.445 |
| Monoisotopic Mass | 322.21441 |
| SMILES | C=C(C)CC/C(=C/CC/C(=C/CC/C(C)=C\CO)CO)C(=O)O |
| InChI | InChI=1S/C19H30O4/c1-15(2)10-11-18(19(22)23)9-5-8-17(14-21)7-4-6-16(3)12-13-20/h7,9,12,20-21H,1,4-6,8,10-11,13-14H2,2-3H3,(H,22,23)/b16-12-,17-7-,18-9- |
| InChIKey | AWJBDWBMFANDQW-KKYKUXRWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Smallanthus sonchifolius (ncbitaxon:185202) | leaf lamina (BTO:0000719) | PubMed (21213966) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| smaditerpenic acid C (CHEBI:147304) has role plant metabolite (CHEBI:76924) |
| smaditerpenic acid C (CHEBI:147304) is a dihydroxy monocarboxylic acid (CHEBI:35972) |
| smaditerpenic acid C (CHEBI:147304) is a diterpenoid (CHEBI:23849) |
| smaditerpenic acid C (CHEBI:147304) is a olefinic compound (CHEBI:78840) |
| smaditerpenic acid C (CHEBI:147304) is a primary allylic alcohol (CHEBI:134394) |
| IUPAC Name |
|---|
| (2Z,6Z,10Z)-12-hydroxy-6-(hydroxymethyl)-10-methyl-2-(3-methylbut-3-en-1-yl)dodeca-2,6,10-trienoic acid |
| Citations |
|---|