EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C52H69N13O11 |
| Net Charge | 0 |
| Average Mass | 1052.204 |
| Monoisotopic Mass | 1051.52395 |
| SMILES | CC[C@H](C)[C@H](NC(=O)[C@@H]1CCCN1C(=O)[C@H](Cc1cncn1)NC(=O)[C@H](CCCCNC(=O)[C@H](CCCNC(=N)N)NC(=O)OCc1ccccc1)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)c1cccnc1)C(=O)O |
| InChI | InChI=1S/C52H69N13O11/c1-3-32(2)43(50(73)74)64-48(71)42-17-11-25-65(42)49(72)41(27-36-29-56-31-59-36)62-46(69)39(60-47(70)40(26-33-18-20-37(66)21-19-33)61-44(67)35-14-9-22-55-28-35)15-7-8-23-57-45(68)38(16-10-24-58-51(53)54)63-52(75)76-30-34-12-5-4-6-13-34/h4-6,9,12-14,18-22,28-29,31-32,38-43,66H,3,7-8,10-11,15-17,23-27,30H2,1-2H3,(H,56,59)(H,57,68)(H,60,70)(H,61,67)(H,62,69)(H,63,75)(H,64,71)(H,73,74)(H4,53,54,58)/t32-,38-,39-,40-,41-,42-,43-/m0/s1 |
| InChIKey | UXGNARZDONUMMK-LRMQDCNJSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | angiotensin receptor agonist A hormone antagonist that acts at angiotensin receptors. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. angiotensin receptor agonist A hormone antagonist that acts at angiotensin receptors. vasodilator agent A drug used to cause dilation of the blood vessels. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| CGP-42112A (CHEBI:147302) has role angiotensin receptor agonist (CHEBI:138416) |
| CGP-42112A (CHEBI:147302) has role anti-inflammatory agent (CHEBI:67079) |
| CGP-42112A (CHEBI:147302) has role antineoplastic agent (CHEBI:35610) |
| CGP-42112A (CHEBI:147302) has role neuroprotective agent (CHEBI:63726) |
| CGP-42112A (CHEBI:147302) has role vasodilator agent (CHEBI:35620) |
| CGP-42112A (CHEBI:147302) is a benzyl ester (CHEBI:90628) |
| CGP-42112A (CHEBI:147302) is a oligopeptide (CHEBI:25676) |
| CGP-42112A (CHEBI:147302) is a pyridinecarboxamide (CHEBI:25529) |
| IUPAC Name |
|---|
| N6-{N2-[(benzyloxy)carbonyl]-L-arginyl}-N2-[N-(pyridin-3-ylcarbonyl)-L-tyrosyl]-L-lysyl-L-histidyl-L-prolyl-L-isoleucine |
| Synonyms | Source |
|---|---|
| CGP42112A | ChemIDplus |
| CGP-42112 | ChemIDplus |
| N6-{N2-[(benzyloxy)carbonyl]-L-arginyl}-N2-[N-(pyridine-3-carbonyl)-L-tyrosyl]-L-lysyl-L-histidyl-L-prolyl-L-isoleucine | IUPAC |
| Nα-nicotinoyl-Tyr-(Nα-Cbz-Arg)-Lys-His-Pro-Ile | ChEBI |
| N6-[[(phenylmethoxy)carbonyl]-L-Arg-]-N2-[[(pyridin-3-yl)carbonyl]-L-Tyr-]-L-Lys-L-His-L-Pro-L-Ile-OH | ChEBI |
| CGP 42112A | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8184948 | Reaxys |
| CAS:127060-75-7 | ChemIDplus |
| Citations |
|---|