EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H2Cl2NO2 |
| Net Charge | -1 |
| Average Mass | 178.982 |
| Monoisotopic Mass | 177.94681 |
| SMILES | [O-]c1cc(Cl)c(O)nc1Cl |
| InChI | InChI=1S/C5H3Cl2NO2/c6-2-1-3(9)4(7)8-5(2)10/h1,9H,(H,8,10)/p-1 |
| InChIKey | NMDKZMIQHHSAFC-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,6-dichloropyridine-2,5-diol(1−) (CHEBI:147301) is a organic anion (CHEBI:25696) |
| 3,6-dichloropyridine-2,5-diol(1−) (CHEBI:147301) is conjugate base of 3,6-dichloropyridine-2,5-diol (CHEBI:144864) |
| Incoming Relation(s) |
| 3,6-dichloropyridine-2,5-diol (CHEBI:144864) is conjugate acid of 3,6-dichloropyridine-2,5-diol(1−) (CHEBI:147301) |
| IUPAC Name |
|---|
| 2,5-dichloro-6-hydroxypyridin-3-olate |
| UniProt Name | Source |
|---|---|
| 3,6-dichloropyridine-2,5-diol | UniProt |