EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H2Cl2O2 |
| Net Charge | 0 |
| Average Mass | 176.986 |
| Monoisotopic Mass | 175.94318 |
| SMILES | O=C1C=C(Cl)C(=O)C(Cl)=C1 |
| InChI | InChI=1S/C6H2Cl2O2/c7-4-1-3(9)2-5(8)6(4)10/h1-2H |
| InChIKey | JCARTGJGWCGSSU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | poison Any substance that causes disturbance to organisms by chemical reaction or other activity on the molecular scale, when a sufficient quantity is absorbed by the organism. carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,6-dichlorobenzoquinone (CHEBI:147298) has role carcinogenic agent (CHEBI:50903) |
| 2,6-dichlorobenzoquinone (CHEBI:147298) has role poison (CHEBI:64909) |
| 2,6-dichlorobenzoquinone (CHEBI:147298) is a 1,4-benzoquinones (CHEBI:132124) |
| 2,6-dichlorobenzoquinone (CHEBI:147298) is a organochlorine compound (CHEBI:36683) |
| IUPAC Name |
|---|
| 2,6-dichlorocyclohexa-2,5-diene-1,4-dione |
| Synonyms | Source |
|---|---|
| 2,6-DCBQ | ChEBI |
| 2,6-dichloquinone | ChemIDplus |
| 2,6-dichloro-1,4-benzoquinone | ChemIDplus |
| 2,6-dichloro-2,5-cyclohexadiene-1,4-dione | ChemIDplus |
| 2,6-dichloro-p-benzoquinone | ChemIDplus |
| 2,6-dichloroquinone | ChemIDplus |
| UniProt Name | Source |
|---|---|
| 2,6-dichlorobenzoquinone | UniProt |
| Citations |
|---|