EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H2Cl2O2 |
| Net Charge | 0 |
| Average Mass | 176.986 |
| Monoisotopic Mass | 175.94318 |
| SMILES | O=C1C=C(Cl)C(=O)C(Cl)=C1 |
| InChI | InChI=1S/C6H2Cl2O2/c7-4-1-3(9)2-5(8)6(4)10/h1-2H |
| InChIKey | JCARTGJGWCGSSU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. poison Any substance that causes disturbance to organisms by chemical reaction or other activity on the molecular scale, when a sufficient quantity is absorbed by the organism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,6-dichlorobenzoquinone (CHEBI:147298) has role carcinogenic agent (CHEBI:50903) |
| 2,6-dichlorobenzoquinone (CHEBI:147298) has role poison (CHEBI:64909) |
| 2,6-dichlorobenzoquinone (CHEBI:147298) is a 1,4-benzoquinones (CHEBI:132124) |
| 2,6-dichlorobenzoquinone (CHEBI:147298) is a organochlorine compound (CHEBI:36683) |
| IUPAC Name |
|---|
| 2,6-dichlorocyclohexa-2,5-diene-1,4-dione |
| Synonyms | Source |
|---|---|
| 2,6-DCBQ | ChEBI |
| 2,6-dichloquinone | ChemIDplus |
| 2,6-dichloro-1,4-benzoquinone | ChemIDplus |
| 2,6-dichloro-2,5-cyclohexadiene-1,4-dione | ChemIDplus |
| 2,6-dichloro-p-benzoquinone | ChemIDplus |
| 2,6-dichloroquinone | ChemIDplus |
| UniProt Name | Source |
|---|---|
| 2,6-dichlorobenzoquinone | UniProt |
| Citations |
|---|