EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H5ClO4 |
| Net Charge | 0 |
| Average Mass | 176.555 |
| Monoisotopic Mass | 175.98764 |
| SMILES | O=C(O)/C=C\C(Cl)=C/C(=O)O |
| InChI | InChI=1S/C6H5ClO4/c7-4(3-6(10)11)1-2-5(8)9/h1-3H,(H,8,9)(H,10,11)/b2-1-,4-3+ |
| InChIKey | ICMVYBXQDUXEEE-BXTBVDPRSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-chloro-cis,cis-muconic acid (CHEBI:1472) has functional parent cis,cis-muconic acid (CHEBI:16508) |
| 3-chloro-cis,cis-muconic acid (CHEBI:1472) is a 3-chloromuconic acid (CHEBI:38428) |
| 3-chloro-cis,cis-muconic acid (CHEBI:1472) is conjugate acid of 3-chloro-cis,cis-muconate(2−) (CHEBI:17589) |
| Incoming Relation(s) |
| 3-chloro-cis,cis-muconate(2−) (CHEBI:17589) is conjugate base of 3-chloro-cis,cis-muconic acid (CHEBI:1472) |
| IUPAC Name |
|---|
| (2E,4Z)-3-chlorohexa-2,4-dienedioic acid |
| Synonyms | Source |
|---|---|
| 3-Chloro-cis,cis-muconate | KEGG COMPOUND |
| (E,Z)-3-chloro-2,4-hexadienedioic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C03585 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2082660 | Reaxys |
| CAS:22752-96-1 | KEGG COMPOUND |
| CAS:22752-96-1 | ChemIDplus |