EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H24N2O2 |
| Net Charge | 0 |
| Average Mass | 336.435 |
| Monoisotopic Mass | 336.18378 |
| SMILES | C=C(C(=O)OC)c1nc2ccccc2c1CCN1C=C(CC)C=CC1 |
| InChI | InChI=1S/C21H24N2O2/c1-4-16-8-7-12-23(14-16)13-11-18-17-9-5-6-10-19(17)22-20(18)15(2)21(24)25-3/h5-10,14,22H,2,4,11-13H2,1,3H3 |
| InChIKey | FGHJSNGBTCVANJ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dehydrosecodine (CHEBI:146301) is a alkaloid ester (CHEBI:38481) |
| dehydrosecodine (CHEBI:146301) is a dihydropyridine (CHEBI:50075) |
| dehydrosecodine (CHEBI:146301) is a enamine (CHEBI:47989) |
| dehydrosecodine (CHEBI:146301) is a indoles (CHEBI:24828) |
| dehydrosecodine (CHEBI:146301) is a methyl ester (CHEBI:25248) |
| dehydrosecodine (CHEBI:146301) is a terpenoid indole alkaloid (CHEBI:65321) |
| dehydrosecodine (CHEBI:146301) is conjugate base of dehydrosecodine(1+) (CHEBI:146237) |
| Incoming Relation(s) |
| dehydrosecodine(1+) (CHEBI:146237) is conjugate acid of dehydrosecodine (CHEBI:146301) |
| IUPAC Name |
|---|
| methyl 2-{3-[2-(5-ethylpyridin-1(2H)-yl)ethyl]-1H-indol-2-yl}prop-2-enoate |
| Manual Xrefs | Databases |
|---|---|
| Dehydrosecodine | Wikipedia |
| CPD-21545 | MetaCyc |