EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| ChEBI ID | CHEBI:146245 |
| ChEBI Name | SR 144528 |
| Stars | |
| Definition | A secondary carboxamide resulting from the formal condensation of the carboxy group of 5-(4-chloro-3-methylphenyl)-1-(4-methylbenzyl)-1H-pyrazole-3-carboxylic acid with the amino group of (1S,2S,4R)-1,3,3-trimethylbicyclo[2.2.1]heptan-2-amine. A potent and selective cannabinoid receptor type 2 (CB2 receptor) inverse agonist (Ki = 0.6 nM). |
| Last Modified | 2 March 2020 |
| Submitter | Ceri |
| Downloads |
| Formula | C29H34ClN3O |
| Net Charge | 0 |
| Average Mass | 476.064 |
| Monoisotopic Mass | 475.23904 |
| SMILES | Cc1ccc(Cn2nc(C(=O)N[C@@H]3C(C)(C)[C@@H]4CC[C@@]3(C)C4)cc2-c2ccc(Cl)c(C)c2)cc1 |
| InChI | InChI=1S/C29H34ClN3O/c1-18-6-8-20(9-7-18)17-33-25(21-10-11-23(30)19(2)14-21)15-24(32-33)26(34)31-27-28(3,4)22-12-13-29(27,5)16-22/h6-11,14-15,22,27H,12-13,16-17H2,1-5H3,(H,31,34)/t22-,27-,29+/m1/s1 |
| InChIKey | SUGVYNSRNKFXQM-XRHWURSXSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | CB2 receptor antagonist An antagonist that binds to and deactivates type 2 cannabinoid receptors. EC 2.3.1.26 (sterol O-acyltransferase) inhibitor An EC 2.3.1.* (acyltransferase transferring other than amino-acyl group) inhibitor that interferes with the action of acyl-CoA:cholesterol acyltransferase (EC 2.3.1.26). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| SR 144528 (CHEBI:146245) has role CB2 receptor antagonist (CHEBI:73417) |
| SR 144528 (CHEBI:146245) has role EC 2.3.1.26 (sterol O-acyltransferase) inhibitor (CHEBI:64696) |
| SR 144528 (CHEBI:146245) is a bridged compound (CHEBI:35990) |
| SR 144528 (CHEBI:146245) is a monochlorobenzenes (CHEBI:83403) |
| SR 144528 (CHEBI:146245) is a pyrazoles (CHEBI:26410) |
| SR 144528 (CHEBI:146245) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| 5-(4-chloro-3-methylphenyl)-1-(4-methylbenzyl)-N-[(1S,2S,4R)-1,3,3-trimethylbicyclo[2.2.1]heptan-2-yl]-1H-pyrazole-3-carboxamide |
| Synonyms | Source |
|---|---|
| SR-144528 | SUBMITTER |
| SR144528 | SUBMITTER |
| 5-(4-chloro-3-methylphenyl)-1-[(4-methylphenyl)methyl]-N-[(1S,2S,4R)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]pyrazole-3-carboxamide | IUPAC |
| (1S-endo)-5-(4-chloro-3-methylphenyl)-1-((4-methylphenyl)methyl)-N-(1,3,3-trimethylbicyclo(2.2.1)hept-2-yl)-1H-pyrazole-3-carboxamide | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| SR-144,528 | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:192703-06-3 | ChemIDplus |
| Citations |
|---|