EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H10Cl2F6N4OS |
| Net Charge | 0 |
| Average Mass | 491.244 |
| Monoisotopic Mass | 489.98566 |
| SMILES | C=C(C)CNc1c([S@+]([O-])C(F)(F)F)c(C#N)nn1-c1c(Cl)cc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C16H10Cl2F6N4OS/c1-7(2)6-26-14-13(30(29)16(22,23)24)11(5-25)27-28(14)12-9(17)3-8(4-10(12)18)15(19,20)21/h3-4,26H,1,6H2,2H3/t30-/m0/s1 |
| InChIKey | HVQHXBNMBZJPLK-PMERELPUSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-flufiprole (CHEBI:146242) is a 1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-5-[(2-methylprop-2-en-1-yl)amino]-4-[(trifluoromethyl)sulfinyl]-1H-pyrazole-3-carbonitrile (CHEBI:146249) |
| (S)-flufiprole (CHEBI:146242) is enantiomer of (R)-flufiprole (CHEBI:146241) |
| Incoming Relation(s) |
| flufiprole (CHEBI:146240) has part (S)-flufiprole (CHEBI:146242) |
| (R)-flufiprole (CHEBI:146241) is enantiomer of (S)-flufiprole (CHEBI:146242) |
| IUPAC Name |
|---|
| 1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-5-[(2-methylprop-2-en-1-yl)amino]-4-[(S)-(trifluoromethyl)sulfinyl]-1H-pyrazole-3-carbonitrile |
| Synonyms | Source |
|---|---|
| (−)-flufiprole | ChEBI |
| S-(−)-flufiprole | ChEBI |
| Citations |
|---|