EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H10Cl2F4N6S |
| Net Charge | 0 |
| Average Mass | 477.274 |
| Monoisotopic Mass | 476.00008 |
| SMILES | N#Cc1nn(-c2c(Cl)cc(C(F)(F)F)cc2Cl)c(NCc2cnccn2)c1SCF |
| InChI | InChI=1S/C17H10Cl2F4N6S/c18-11-3-9(17(21,22)23)4-12(19)14(11)29-16(15(30-8-20)13(5-24)28-29)27-7-10-6-25-1-2-26-10/h1-4,6,27H,7-8H2 |
| InChIKey | DDIQWGKUSJOETH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pyrafluprole (CHEBI:146239) is a (trifluoromethyl)benzenes (CHEBI:83565) |
| pyrafluprole (CHEBI:146239) is a dichlorobenzene (CHEBI:23697) |
| pyrafluprole (CHEBI:146239) is a nitrile (CHEBI:18379) |
| pyrafluprole (CHEBI:146239) is a organic sulfide (CHEBI:16385) |
| pyrafluprole (CHEBI:146239) is a phenylpyrazole insecticide (CHEBI:39090) |
| IUPAC Name |
|---|
| 1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-[(fluoromethyl)sulfanyl]-5-[(pyrazin-2-ylmethyl)amino]-1H-pyrazole-3-carbonitrile |
| Synonyms | Source |
|---|---|
| 1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-[(fluoromethyl)thio]-5-[(2-pyrazinylmethyl)amino]-1H-pyrazole-3-carbonitrile | Alan Wood's Pesticides |
| 1-(2,6-dichloro-α,α,α-trifluoro-p-tolyl)-4-[(fluoromethyl)thio]-5-[(pyrazinylmethyl)amino]-1H-pyrazole-3-carbonitrile | Alan Wood's Pesticides |
| V 3039 | ChEBI |
| V-3039 | ChEBI |
| V3039 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 3071 | PPDB |
| pyrafluprole | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18528378 | Reaxys |
| CAS:315208-17-4 | ChemIDplus |
| Citations |
|---|