EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H16ClNO |
| Net Charge | 0 |
| Average Mass | 213.708 |
| Monoisotopic Mass | 213.09204 |
| SMILES | CC(C)NC[C@@H](O)c1ccccc1Cl |
| InChI | InChI=1S/C11H16ClNO/c1-8(2)13-7-11(14)9-5-3-4-6-10(9)12/h3-6,8,11,13-14H,7H2,1-2H3/t11-/m1/s1 |
| InChIKey | SSMSBSWKLKKXGG-LLVKDONJSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-clorprenaline (CHEBI:146225) is a 1-(2-chlorophenyl)-2-isopropylaminoethanol (CHEBI:146226) |
| (S)-clorprenaline (CHEBI:146225) is enantiomer of (R)-clorprenaline (CHEBI:146224) |
| Incoming Relation(s) |
| clorprenaline (CHEBI:134887) has part (S)-clorprenaline (CHEBI:146225) |
| (R)-clorprenaline (CHEBI:146224) is enantiomer of (S)-clorprenaline (CHEBI:146225) |
| IUPAC Name |
|---|
| (1S)-1-(2-chlorophenyl)-2-(propan-2-ylamino)ethanol |
| Synonyms | Source |
|---|---|
| (1S)-1-(2-chlorophenyl)-2-[(propan-2-yl)amino]ethan-1-ol | IUPAC |
| (+)-clorprenaline | ChemIDplus |
| (S)- 1-(2-chlorophenyl)-2-isopropylaminoethanol | ChEBI |
| (S)-1-(o-chlorophenyl)-2-(isopropylamino)ethanol | ChEBI |
| (+)-isoprophenamine | ChEBI |
| D-clorprenaline | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:29261-25-4 | ChemIDplus |