EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H39NO4S |
| Net Charge | 0 |
| Average Mass | 389.602 |
| Monoisotopic Mass | 389.25998 |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)NCCS(=O)(=O)O |
| InChI | InChI=1S/C20H39NO4S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(22)21-18-19-26(23,24)25/h9-10H,2-8,11-19H2,1H3,(H,21,22)(H,23,24,25)/b10-9- |
| InChIKey | KOGRJTUIKPMZEJ-KTKRTIGZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| blood serum (BTO:0000133) | PubMed (29878065) | ||
| blood plasma (BTO_0000131) | PubMed (31740614) |
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. human blood serum metabolite Any metabolite (endogenous or exogenous) found in human blood serum samples. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-oleoyltaurine (CHEBI:146206) has functional parent oleic acid (CHEBI:16196) |
| N-oleoyltaurine (CHEBI:146206) has role antineoplastic agent (CHEBI:35610) |
| N-oleoyltaurine (CHEBI:146206) has role apoptosis inducer (CHEBI:68495) |
| N-oleoyltaurine (CHEBI:146206) has role human blood serum metabolite (CHEBI:85234) |
| N-oleoyltaurine (CHEBI:146206) is a fatty acid-taurine conjugate (CHEBI:132474) |
| N-oleoyltaurine (CHEBI:146206) is conjugate acid of N-oleoyltaurine(1−) (CHEBI:146191) |
| Incoming Relation(s) |
| N-oleoyltaurine(1−) (CHEBI:146191) is conjugate base of N-oleoyltaurine (CHEBI:146206) |
| IUPAC Name |
|---|
| 2-[(9Z)-octadec-9-enoylamino]ethanesulfonic acid |
| Synonyms | Source |
|---|---|
| oleoyltaurine | ChemIDplus |
| 2-{[(9Z)-octadec-9-enoyl]amino}ethane-1-sulfonic acid | IUPAC |
| 2-[(1-oxo-9Z-octadecenyl)amino]-ethanesulfonic acid | ChEBI |
| N-oleoyl taurine | LIPID MAPS |
| N-(9Z-octadecenoyl)-taurine | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| LMFA08020081 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:52514-04-2 | ChemIDplus |
| Citations |
|---|