EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H33NO |
| Net Charge | 0 |
| Average Mass | 255.446 |
| Monoisotopic Mass | 255.25621 |
| SMILES | CCCCCCCCCCCCCC(=O)N(C)C |
| InChI | InChI=1S/C16H33NO/c1-4-5-6-7-8-9-10-11-12-13-14-15-16(18)17(2)3/h4-15H2,1-3H3 |
| InChIKey | FQXSTGKJHBFSIQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N,N-dimethyltetradecanamide (CHEBI:146190) has functional parent dimethylamine (CHEBI:17170) |
| N,N-dimethyltetradecanamide (CHEBI:146190) has functional parent tetradecanoic acid (CHEBI:28875) |
| N,N-dimethyltetradecanamide (CHEBI:146190) has role epitope (CHEBI:53000) |
| N,N-dimethyltetradecanamide (CHEBI:146190) is a fatty amide (CHEBI:29348) |
| IUPAC Name |
|---|
| N,N-dimethyltetradecanamide |
| Synonyms | Source |
|---|---|
| dimethyl myristamide | ChemIDplus |
| N,N-dimethylmyristamide | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1776317 | Beilstein |
| CAS:3015-65-4 | ChemIDplus |
| Citations |
|---|