EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H36N4O6 |
| Net Charge | 0 |
| Average Mass | 584.673 |
| Monoisotopic Mass | 584.26348 |
| SMILES | C=CC1=C(C)/C(=C/C2=N/C(=C\c3nc(/C=C4\NC(=O)[C@H](C)\C4=C/C)c(C)c3CCC(=O)O)C(CCC(=O)O)=C2C)NC1=O |
| InChI | InChI=1S/C33H36N4O6/c1-7-20-19(6)32(42)37-27(20)14-25-18(5)23(10-12-31(40)41)29(35-25)15-28-22(9-11-30(38)39)17(4)24(34-28)13-26-16(3)21(8-2)33(43)36-26/h7-8,13-15,19,35H,2,9-12H2,1,3-6H3,(H,36,43)(H,37,42)(H,38,39)(H,40,41)/b20-7+,26-13-,27-14-,28-15-/t19-/m1/s1 |
| InChIKey | DKMLMZVDTGOEGU-UAWLBFNISA-N |
| Roles Classification |
|---|
| Chemical Role: | phytochrome chromophore A chromophore that is a linear tetrapyrrolic prosthetic group covalently attached to a large soluble protein phytochrome. Light absorption by the phytochrome chromophore triggers photoconversion between two spectrally distinct forms of the photoreceptor: Pr, the red light absorbing form, and Pfr, the far-red light absorbing form. |
| Biological Role: | cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3E)-phytochromobilin (CHEBI:146182) is a phytochromobilin (CHEBI:26116) |
| IUPAC Name |
|---|
| 3-(2-[(Z)-{3-(2-carboxyethyl)-5-[(Z)-(4-ethenyl-3-methyl-5-oxo-1,5-dihydro-2H-pyrrol-2-ylidene)methyl]-4-methyl-2H-pyrrol-2-ylidene}methyl]-5-{(Z)-[(3E,4R)-3-ethylidene-4-methyl-5-oxopyrrolidin-2-ylidene]methyl}-4-methyl-1H-pyrrol-3-yl)propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| CPD-15004 | MetaCyc |
| Citations |
|---|