EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H14O2 |
| Net Charge | 0 |
| Average Mass | 238.286 |
| Monoisotopic Mass | 238.09938 |
| SMILES | O=C(/C=C/c1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C16H14O2/c17-16(12-11-14-7-3-1-4-8-14)18-13-15-9-5-2-6-10-15/h1-12H,13H2/b12-11+ |
| InChIKey | NGHOLYJTSCBCGC-VAWYXSNFSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Biological Roles: | flavouring agent A food additive that is used to added improve the taste or odour of a food. epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. antigen Any substance that stimulates an immune response in the body, such as through antibody production or by presentation to a T-cell receptor after binding to a major histocompability complex (MHC). fixative Any compound used for the purpose of preserving biological tissues from decay in such a way as to allow for the preparation of thin, stained sections for subsequent histological study. |
| Applications: | flavouring agent A food additive that is used to added improve the taste or odour of a food. fragrance A substance, extract, or preparation for diffusing or imparting an agreeable or attractive smell. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benzyl cinnamate (CHEBI:146174) has role antigen (CHEBI:59132) |
| benzyl cinnamate (CHEBI:146174) has role epitope (CHEBI:53000) |
| benzyl cinnamate (CHEBI:146174) has role fixative (CHEBI:50913) |
| benzyl cinnamate (CHEBI:146174) has role flavouring agent (CHEBI:35617) |
| benzyl cinnamate (CHEBI:146174) has role fragrance (CHEBI:48318) |
| benzyl cinnamate (CHEBI:146174) is a cinnamate ester (CHEBI:36087) |
| IUPAC Name |
|---|
| benzyl (2E)-3-phenylprop-2-enoate |
| Synonyms | Source |
|---|---|
| 3-phenyl-2-propenoic acid, phenylmethyl ester | ChemIDplus |
| benzyl (2E)-3-phenylacrylate | IUPAC |
| Benzyl alcohol, cinnamic ester | ChemIDplus |
| trans-Cinnamic acid benzyl ester | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Benzyl_cinnamate | Wikipedia |
| Citations |
|---|