EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H8O4 |
| Net Charge | 0 |
| Average Mass | 168.148 |
| Monoisotopic Mass | 168.04226 |
| SMILES | COC1=C(O)C(=O)C(C)=CC1=O |
| InChI | InChI=1S/C8H8O4/c1-4-3-5(9)8(12-2)7(11)6(4)10/h3,11H,1-2H3 |
| InChIKey | GSNBWTFAGXSQCO-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus fumigatus (ncbitaxon:746128) | - | PubMed (31124) |
| Roles Classification |
|---|
| Biological Roles: | mycotoxin Poisonous substance produced by fungi. Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fumigatin (CHEBI:146171) has functional parent 2,3-dihydroxy-5-methyl-1,4-benzoquinone (CHEBI:46691) |
| fumigatin (CHEBI:146171) has role Aspergillus metabolite (CHEBI:76956) |
| fumigatin (CHEBI:146171) has role mycotoxin (CHEBI:25442) |
| fumigatin (CHEBI:146171) is a monohydroxy-1,4-benzoquinones (CHEBI:67273) |
| IUPAC Name |
|---|
| 3-hydroxy-2-methoxy-5-methylcyclohexa-2,5-diene-1,4-dione |
| Synonyms | Source |
|---|---|
| 3-demethylubiquinone 0 | ChEBI |
| 3-hydroxy-2-methoxy-5-methyl-1,4-benzoquinone | ChEBI |
| 3-hydroxy-2-methoxy-5-methyl-2,5-cyclohexadiene-1,4-dione | ChEBI |
| fumigatin | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:484-89-9 | ChemIDplus |
| Citations |
|---|