EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H32O5 |
| Net Charge | 0 |
| Average Mass | 400.515 |
| Monoisotopic Mass | 400.22497 |
| SMILES | [H][C@]12CC[C@]3(C)[C@@H](c4ccc(=O)oc4)C[C@H]4O[C@]43[C@]1([H])CC[C@]1(O)C[C@@H](O)CC[C@@]12C |
| InChI | InChI=1S/C24H32O5/c1-21-8-5-15(25)12-23(21,27)10-7-17-16(21)6-9-22(2)18(11-19-24(17,22)29-19)14-3-4-20(26)28-13-14/h3-4,13,15-19,25,27H,5-12H2,1-2H3/t15-,16-,17+,18+,19+,21+,22+,23-,24+/m0/s1 |
| InChIKey | JMNQTHQLNRILMH-OBBGIPBRSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rhinella rubescens (ncbitaxon:752686) | - | PubMed (31879340) | |
| Rhinella marina (ncbitaxon:8386) | - | PubMed (31879340) |
| Roles Classification |
|---|
| Biological Roles: | epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. EC 3.6.3.9 (Na(+)/K(+)-transporting ATPase) inhibitor An EC 3.6.3.* (acid anhydride hydrolase catalysing transmembrane movement of substances) inhibitor that interferes with the action of Na+/K+-transporting ATPase (EC 3.6.3.9). hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| marinobufagenin (CHEBI:146151) has functional parent (5β)-bufadienolide (CHEBI:83977) |
| marinobufagenin (CHEBI:146151) has role EC 3.6.3.9 (Na+/K+-transporting ATPase) inhibitor (CHEBI:63510) |
| marinobufagenin (CHEBI:146151) has role epitope (CHEBI:53000) |
| marinobufagenin (CHEBI:146151) is a epoxy steroid (CHEBI:145217) |
| marinobufagenin (CHEBI:146151) is a steroid hormone (CHEBI:26764) |
| IUPAC Name |
|---|
| 3β,5-dihydroxy-5β,15β-14,15-epoxybufa-20,22-dienolide |
| Synonyms | Source |
|---|---|
| (3beta,5beta,14alpha,15beta)-3,5-dihydroxy-14,15-epoxybufa-20,22-dienolide | PDBeChem |
| Marinobufagin | ChemIDplus |
| MBG | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| P4S | PDBeChem |
| Marinobufagenin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:470-42-8 | ChemIDplus |
| Citations |
|---|