EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H14O6 |
| Net Charge | 0 |
| Average Mass | 314.293 |
| Monoisotopic Mass | 314.07904 |
| SMILES | COc1ccc(-c2oc3cc(O)cc(O)c3c(=O)c2OC)cc1 |
| InChI | InChI=1S/C17H14O6/c1-21-11-5-3-9(4-6-11)16-17(22-2)15(20)14-12(19)7-10(18)8-13(14)23-16/h3-8,18-19H,1-2H3 |
| InChIKey | RJCJVIFSIXKSAH-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Betula pendula (ncbitaxon:3505) | - | DOI (/10.1134/S1068162012070217) | |
| Flourensia cernua (IPNI:277219-2) | aerial part (BTO:0001658) | PubMed (12946427) | |
| Haplopappus sonoriensis (IPNI:117771-2) | whole plant (BTO:0001461) | PubMed (12727485) | |
| Juglans regia (ncbitaxon:51240) | leaf (BTO:0000713) | PubMed (24467376) | |
| Lagochilus proskorjacovii (ncbitaxon:694359) | - | DOI (/10.1007/BF00598277) | Isolated from epigeal part. |
| Phlomis samia (ncbitaxon:997739) | aerial part (BTO:0001658) | PubMed (11520237) | |
| Propolis (ncbitaxon:931589) | - | DOI (/10.1007/BF00568574) | |
| Tanacetum microphyllum (ncbitaxon:127997) | - | PubMed (9051913) |
| Roles Classification |
|---|
| Biological Roles: | antimycobacterial drug A drug used to treat or prevent infections caused by Mycobacteria, a genus of actinobacteria. Aerobic and nonmotile, members of the genus include the pathogens responsible for causing tuberculosis and leprosy. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antimycobacterial drug A drug used to treat or prevent infections caused by Mycobacteria, a genus of actinobacteria. Aerobic and nonmotile, members of the genus include the pathogens responsible for causing tuberculosis and leprosy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,4'-dimethylkaempferol (CHEBI:146142) has functional parent kaempferol (CHEBI:28499) |
| 3,4'-dimethylkaempferol (CHEBI:146142) has role anti-inflammatory agent (CHEBI:67079) |
| 3,4'-dimethylkaempferol (CHEBI:146142) has role antimycobacterial drug (CHEBI:64912) |
| 3,4'-dimethylkaempferol (CHEBI:146142) has role antineoplastic agent (CHEBI:35610) |
| 3,4'-dimethylkaempferol (CHEBI:146142) has role apoptosis inducer (CHEBI:68495) |
| 3,4'-dimethylkaempferol (CHEBI:146142) has role plant metabolite (CHEBI:76924) |
| 3,4'-dimethylkaempferol (CHEBI:146142) is a dihydroxyflavone (CHEBI:38686) |
| 3,4'-dimethylkaempferol (CHEBI:146142) is a dimethoxyflavone (CHEBI:23798) |
| IUPAC Name |
|---|
| 5,7-dihydroxy-3-methoxy-2-(4-methoxyphenyl)-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 3,4'-dimethoxy-5,7-dihydroxyflavone | ChEBI |
| 3,4'-dimethoxychrysin | ChEBI |
| 3,4'-dimethoxykaempferol | ChEBI |
| 3,4'-O-dimethylkaempferol | ChEBI |
| 5,7-dihydroxy-3,4'-dimethoxyflavone | LIPID MAPS |
| 5,7-dihydroxy-3-methoxy-2-(4-methoxyphenyl)-4-benzopyrone | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| CPD-14952 | MetaCyc |
| Ermanin | Wikipedia |
| LMPK12112697 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:20869-95-8 | ChemIDplus |
| Citations |
|---|