EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H14O6 |
| Net Charge | 0 |
| Average Mass | 314.293 |
| Monoisotopic Mass | 314.07904 |
| SMILES | COc1ccc(-c2oc3cc(O)cc(O)c3c(=O)c2OC)cc1 |
| InChI | InChI=1S/C17H14O6/c1-21-11-5-3-9(4-6-11)16-17(22-2)15(20)14-12(19)7-10(18)8-13(14)23-16/h3-8,18-19H,1-2H3 |
| InChIKey | RJCJVIFSIXKSAH-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Tanacetum microphyllum (ncbitaxon:127997) | - | PubMed (9051913) | |
| Phlomis samia (ncbitaxon:997739) | aerial part (BTO:0001658) | PubMed (11520237) | |
| Flourensia cernua (IPNI:277219-2) | aerial part (BTO:0001658) | PubMed (12946427) | |
| Lagochilus proskorjacovii (ncbitaxon:694359) | - | DOI (/10.1007/BF00598277) | Isolated from epigeal part. |
| Betula pendula (ncbitaxon:3505) | - | DOI (/10.1134/S1068162012070217) | |
| Propolis (ncbitaxon:931589) | - | DOI (/10.1007/BF00568574) | |
| Haplopappus sonoriensis (IPNI:117771-2) | whole plant (BTO:0001461) | PubMed (12727485) | |
| Juglans regia (ncbitaxon:51240) | leaf (BTO:0000713) | PubMed (24467376) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. antimycobacterial drug A drug used to treat or prevent infections caused by Mycobacteria, a genus of actinobacteria. Aerobic and nonmotile, members of the genus include the pathogens responsible for causing tuberculosis and leprosy. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Applications: | antimycobacterial drug A drug used to treat or prevent infections caused by Mycobacteria, a genus of actinobacteria. Aerobic and nonmotile, members of the genus include the pathogens responsible for causing tuberculosis and leprosy. anti-inflammatory agent Any compound that has anti-inflammatory effects. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,4'-dimethylkaempferol (CHEBI:146142) has functional parent kaempferol (CHEBI:28499) |
| 3,4'-dimethylkaempferol (CHEBI:146142) has role anti-inflammatory agent (CHEBI:67079) |
| 3,4'-dimethylkaempferol (CHEBI:146142) has role antimycobacterial drug (CHEBI:64912) |
| 3,4'-dimethylkaempferol (CHEBI:146142) has role antineoplastic agent (CHEBI:35610) |
| 3,4'-dimethylkaempferol (CHEBI:146142) has role apoptosis inducer (CHEBI:68495) |
| 3,4'-dimethylkaempferol (CHEBI:146142) has role plant metabolite (CHEBI:76924) |
| 3,4'-dimethylkaempferol (CHEBI:146142) is a dihydroxyflavone (CHEBI:38686) |
| 3,4'-dimethylkaempferol (CHEBI:146142) is a dimethoxyflavone (CHEBI:23798) |
| IUPAC Name |
|---|
| 5,7-dihydroxy-3-methoxy-2-(4-methoxyphenyl)-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 5,7-dihydroxy-3-methoxy-2-(4-methoxyphenyl)-4H-1-benzopyran-4-one | IUPAC |
| kaempferol 3,4'-dimethyl ether | MetaCyc |
| 5,7-dihydroxy-3,4'-dimethoxyflavone | LIPID MAPS |
| ermanin | ChemIDplus |
| 5,7-dihydroxy-3-methoxy-2-(4-methoxyphenyl)-4-benzopyrone | ChemIDplus |
| 3,4'-dimethoxykaempferol | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-14952 | MetaCyc |
| Ermanin | Wikipedia |
| LMPK12112697 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:20869-95-8 | ChemIDplus |
| Citations |
|---|