EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H18O8 |
| Net Charge | 0 |
| Average Mass | 374.345 |
| Monoisotopic Mass | 374.10017 |
| SMILES | COc1cc(-c2oc3cc(O)cc(O)c3c(=O)c2OC)cc(OC)c1OC |
| InChI | InChI=1S/C19H18O8/c1-23-13-5-9(6-14(24-2)18(13)25-3)17-19(26-4)16(22)15-11(21)7-10(20)8-12(15)27-17/h5-8,20-21H,1-4H3 |
| InChIKey | YSXLGTWJLNLXKQ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bridelia ferruginea (ncbitaxon:319147) | bark (BTO:0001301) | PubMed (17260306) | Isolated from stem bark. |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,3',4',5'-tetramethylmyricetin (CHEBI:146139) has functional parent myricetin (CHEBI:18152) |
| 3,3',4',5'-tetramethylmyricetin (CHEBI:146139) has role plant metabolite (CHEBI:76924) |
| 3,3',4',5'-tetramethylmyricetin (CHEBI:146139) is a 3'-methoxyflavones (CHEBI:138730) |
| 3,3',4',5'-tetramethylmyricetin (CHEBI:146139) is a dihydroxyflavone (CHEBI:38686) |
| 3,3',4',5'-tetramethylmyricetin (CHEBI:146139) is a tetramethoxyflavone (CHEBI:76875) |
| IUPAC Name |
|---|
| 5,7-dihydroxy-3-methoxy-2-(3,4,5-trimethoxyphenyl)-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 3,3',4',5'-tetra-O-methylmyricetin | ChEBI |
| 5,7-dihydroxy-3,3',4',5'-tetramethoxyflavone | LIPID MAPS |
| 5,7-dihydroxy-3-methoxy-2-(3,4,5-trimethoxyphenyl)-4H-1-benzopyran-4-one | IUPAC |
| myricetin 3,3',4',5'-tetramethyl ether | MetaCyc |
| Manual Xrefs | Databases |
|---|---|
| CPD-14941 | MetaCyc |
| LMPK12112793 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:14585-04-7 | ChEBI |
| Citations |
|---|