EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H14O7 |
| Net Charge | 0 |
| Average Mass | 330.292 |
| Monoisotopic Mass | 330.07395 |
| SMILES | COc1cc(-c2oc3cc(O)cc(O)c3c(=O)c2OC)ccc1O |
| InChI | InChI=1S/C17H14O7/c1-22-12-5-8(3-4-10(12)19)16-17(23-2)15(21)14-11(20)6-9(18)7-13(14)24-16/h3-7,18-20H,1-2H3 |
| InChIKey | FMEHGPQTMOPUGM-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Artemisia heptapotamica (ncbitaxon:1903203) | - | DOI (/10.1007/BF00598777) | |
| Elaeagnus pungens (ncbitaxon:693372) | leaf (BTO:0000713) | PubMed (16722375) | |
| Halimodendron halodendron (ncbitaxon:47657) | aerial part (BTO:0001658) | PubMed (23109858) | |
| Inula viscosa (ncbitaxon:56525) | - | PubMed (22418930) | |
| Rumex aquaticus (ncbitaxon:1470351) | - | PubMed (28300698) | |
| Viscum coloratum (ncbitaxon:159976) | - | PubMed (22041066) |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,3'-dimethylquercetin (CHEBI:146138) has functional parent quercetin (CHEBI:16243) |
| 3,3'-dimethylquercetin (CHEBI:146138) has role antibacterial agent (CHEBI:33282) |
| 3,3'-dimethylquercetin (CHEBI:146138) has role antineoplastic agent (CHEBI:35610) |
| 3,3'-dimethylquercetin (CHEBI:146138) has role apoptosis inducer (CHEBI:68495) |
| 3,3'-dimethylquercetin (CHEBI:146138) has role plant metabolite (CHEBI:76924) |
| 3,3'-dimethylquercetin (CHEBI:146138) is a 3'-methoxyflavones (CHEBI:138730) |
| 3,3'-dimethylquercetin (CHEBI:146138) is a dimethoxyflavone (CHEBI:23798) |
| 3,3'-dimethylquercetin (CHEBI:146138) is a trihydroxyflavone (CHEBI:27116) |
| IUPAC Name |
|---|
| 5,7-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-3-methoxy-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 3,3'-di-O-methylquercetin | ChemIDplus |
| 3,3'-dimethoxyquercetin | ChemIDplus |
| 3,3'-O-dimethyl quercetin | ChEBI |
| 3-O-methylisorhamnetin | ChEBI |
| 4',5,7-trihydroxy-3,3'-dimethoxyflavone | ChEBI |
| 5,7,4'-trihydroxy-3,3'-dimethoxyflavone | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| CPD-14946 | MetaCyc |
| LMPK12112752 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:4382-17-6 | ChemIDplus |
| Citations |
|---|