EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H16O8 |
| Net Charge | 0 |
| Average Mass | 360.318 |
| Monoisotopic Mass | 360.08452 |
| SMILES | COc1cc(-c2oc3cc(O)cc(O)c3c(=O)c2OC)cc(OC)c1O |
| InChI | InChI=1S/C18H16O8/c1-23-12-4-8(5-13(24-2)15(12)21)17-18(25-3)16(22)14-10(20)6-9(19)7-11(14)26-17/h4-7,19-21H,1-3H3 |
| InChIKey | PLORYRPFPGAIDS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,3',5'-trimethylmyricetin (CHEBI:146132) has functional parent myricetin (CHEBI:18152) |
| 3,3',5'-trimethylmyricetin (CHEBI:146132) has role plant metabolite (CHEBI:76924) |
| 3,3',5'-trimethylmyricetin (CHEBI:146132) is a trihydroxyflavone (CHEBI:27116) |
| 3,3',5'-trimethylmyricetin (CHEBI:146132) is a trimethoxyflavone (CHEBI:27124) |
| IUPAC Name |
|---|
| 5,7-dihydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)-3-methoxy-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 3',5',3-dimethyl myricetin | ChEBI |
| 5,7-dihydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)-3-methoxy-4H-1-benzopyran-4-one | IUPAC |
| myricetin 3,3',5'-trimethyl ether | MetaCyc |
| Manual Xrefs | Databases |
|---|---|
| CPD-14938 | MetaCyc |
| LMPK12112783 | LIPID MAPS |
| Citations |
|---|