EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:1461 - 3-butynoic acid
| Formula | C4H4O2 |
| Net Charge | 0 |
| Average Mass | 84.074 |
| Monoisotopic Mass | 84.02113 |
| SMILES | C#CCC(=O)O |
| InChI | InChI=1S/C4H4O2/c1-2-3-4(5)6/h1H,3H2,(H,5,6) |
| InChIKey | KKAHGSQLSTUDAV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-butynoic acid (CHEBI:1461) is a monocarboxylic acid (CHEBI:25384) |
| 3-butynoic acid (CHEBI:1461) is a terminal acetylenic compound (CHEBI:73477) |
| 3-butynoic acid (CHEBI:1461) is conjugate acid of 3-butynoate (CHEBI:62211) |
| Incoming Relation(s) |
| 3-butynoate (CHEBI:62211) is conjugate base of 3-butynoic acid (CHEBI:1461) |
| IUPAC Name |
|---|
| but-3-ynoic acid |
| Synonyms | Source |
|---|---|
| But-3-insäure | ChEBI |
| CH≡CCH2COOH | NIST Chemistry WebBook |
| But-3-ynoate | KEGG COMPOUND |
| Citations |
|---|