EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H18O10 |
| Net Charge | 0 |
| Average Mass | 514.442 |
| Monoisotopic Mass | 514.09000 |
| SMILES | Cc1cc(=O)c2c(O)c3c(O)cc(O)c(-c4c(O)cc(O)c5c(O)c6c(=O)cc(C)oc6cc45)c3cc2o1 |
| InChI | InChI=1S/C28H18O10/c1-9-3-13(29)25-19(37-9)5-11-21(15(31)7-17(33)23(11)27(25)35)22-12-6-20-26(14(30)4-10(2)38-20)28(36)24(12)18(34)8-16(22)32/h3-8,31-36H,1-2H3 |
| InChIKey | GCSBLYZTGOQVPI-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus tubingensis (ncbitaxon:5068) | - | PubMed (31878243) | |
| Ustilaginoidea virens (ncbitaxon:1159556) | - | DOI (/10.1016/S0040-4039(01)90914-1) |
| Roles Classification |
|---|
| Biological Role: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ustilaginoidin A (CHEBI:146013) has role Aspergillus metabolite (CHEBI:76956) |
| ustilaginoidin A (CHEBI:146013) is a benzochromenone (CHEBI:64986) |
| ustilaginoidin A (CHEBI:146013) is a binaphthopyran (CHEBI:146014) |
| ustilaginoidin A (CHEBI:146013) is a naphtho-γ-pyrone (CHEBI:64542) |
| ustilaginoidin A (CHEBI:146013) is a phenols (CHEBI:33853) |
| ustilaginoidin A (CHEBI:146013) is conjugate acid of ustilaginoidin A(2−) (CHEBI:145840) |
| Incoming Relation(s) |
| ustilaginoidin A(2−) (CHEBI:145840) is conjugate base of ustilaginoidin A (CHEBI:146013) |
| IUPAC Name |
|---|
| (9M)-5,5',6,6',8,8'-hexahydroxy-2,2'-dimethyl-7,8-dihydro-4H,4'H-[9,9'-binaphtho[2,3-b]pyran]-4,4'-dione |
| Synonyms | Source |
|---|---|
| 5,5',6,6',8,8'-hexahydroxy-2,2'-dimethyl-4H,4'H-[9,9'-bibenzo[g]chromene]-4,4'-dione | IUPAC |
| 5,5',6,6',8,8'-hexahydroxy-2,2'-dimethyl-4H,4'H-[9,9'-binaphtho[2,3-b]pyran]-4,4'-dione | IUPAC |
| 9,9'-bisnorrubrofusarin | ChEBI |
| didehydrocephalochromin | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:3692-07-7 | ChemIDplus |
| Citations |
|---|