EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| ChEBI ID | CHEBI:146004 |
| ChEBI Name | monapinone E |
| Stars | |
| Definition | A naphthopyran that is 3,4-dihydronaphtho[2,3-c]pyran-1-one which is substituted by a (2R,4R)-2,4,9-trihydroxynonyl group at position 3 and a methoxy group at position 7. Published in Acta Pharm. Sin. B, 2013, 3, 163-166. See also J. Antibiot., 2011, 64, 503-508. |
| Last Modified | 9 March 2020 |
| Submitter | Kristian Axelsen |
| Downloads |
| Formula | C23H30O8 |
| Net Charge | 0 |
| Average Mass | 434.485 |
| Monoisotopic Mass | 434.19407 |
| SMILES | COc1cc(O)c2c(O)c3c(cc2c1)C[C@@H](C[C@H](O)C[C@H](O)CCCCCO)OC3=O |
| InChI | InChI=1S/C23H30O8/c1-30-17-8-13-7-14-9-18(11-16(26)10-15(25)5-3-2-4-6-24)31-23(29)21(14)22(28)20(13)19(27)12-17/h7-8,12,15-16,18,24-28H,2-6,9-11H2,1H3/t15-,16-,18+/m1/s1 |
| InChIKey | YHQGYEAIRQPZFF-NUJGCVRESA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| monapinone E (CHEBI:146004) is a aromatic ether (CHEBI:35618) |
| monapinone E (CHEBI:146004) is a naphtho-α-pyrone (CHEBI:146280) |
| monapinone E (CHEBI:146004) is a phenols (CHEBI:33853) |
| monapinone E (CHEBI:146004) is a primary alcohol (CHEBI:15734) |
| monapinone E (CHEBI:146004) is a secondary alcohol (CHEBI:35681) |
| monapinone E (CHEBI:146004) is a δ-lactone (CHEBI:18946) |
| Incoming Relation(s) |
| dinapinone E (CHEBI:146005) has functional parent monapinone E (CHEBI:146004) |
| IUPAC Name |
|---|
| (3S)-9,10-dihydroxy-7-methoxy-3-[(2R,4R)-2,4,9-trihydroxynonyl]-3,4-dihydro-1H-naphtho[2,3-c]pyran-1-one |
| UniProt Name | Source |
|---|---|
| monapinone E | UniProt |
| Citations |
|---|