EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H26NO11S2 |
| Net Charge | -1 |
| Average Mass | 508.547 |
| Monoisotopic Mass | 508.09528 |
| SMILES | O=C(OCCCCC/C(=N\OS(=O)(=O)[O-])S[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)c1ccccc1 |
| InChI | InChI=1S/C19H27NO11S2/c21-11-13-15(22)16(23)17(24)19(30-13)32-14(20-31-33(26,27)28)9-5-2-6-10-29-18(25)12-7-3-1-4-8-12/h1,3-4,7-8,13,15-17,19,21-24H,2,5-6,9-11H2,(H,26,27,28)/p-1/b20-14+/t13-,15-,16+,17-,19+/m1/s1 |
| InChIKey | LGEQIQASZQVYEB-CLHCNKLFSA-M |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-benzoyloxypentyl glucosinolate (CHEBI:145997) is a glucosinolate (CHEBI:24279) |