EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C38H38O12 |
| Net Charge | 0 |
| Average Mass | 686.710 |
| Monoisotopic Mass | 686.23633 |
| SMILES | [H][C@@]1([C@@H](C)OC(C)=O)c2cc3ccc(-c4ccc5cc6c(c(O)c5c4O)C(=O)C[C@](C)(O)[C@]6([H])[C@@H](C)OC(C)=O)c(O)c3c(O)c2C(=O)C[C@]1(C)O |
| InChI | InChI=1S/C38H38O12/c1-15(49-17(3)39)31-23-11-19-7-9-21(33(43)27(19)35(45)29(23)25(41)13-37(31,5)47)22-10-8-20-12-24-30(36(46)28(20)34(22)44)26(42)14-38(6,48)32(24)16(2)50-18(4)40/h7-12,15-16,31-32,43-48H,13-14H2,1-6H3/t15-,16-,31-,32-,37+,38+/m1/s1 |
| InChIKey | UYEWMDUNNUBCMC-WJUADSEPSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| julichrome Q6-6 (CHEBI:145987) has functional parent julichrome Q6 (CHEBI:145986) |
| julichrome Q6-6 (CHEBI:145987) is a acetate ester (CHEBI:47622) |
| julichrome Q6-6 (CHEBI:145987) is a bianthracenes (CHEBI:145988) |
| julichrome Q6-6 (CHEBI:145987) is a cyclic ketone (CHEBI:3992) |
| julichrome Q6-6 (CHEBI:145987) is a polyketide (CHEBI:26188) |
| julichrome Q6-6 (CHEBI:145987) is a tertiary alcohol (CHEBI:26878) |
| julichrome Q6-6 (CHEBI:145987) is conjugate acid of julichrome Q6-6(1−) (CHEBI:146003) |
| Incoming Relation(s) |
| julichrome Q6-6(1−) (CHEBI:146003) is conjugate base of julichrome Q6-6 (CHEBI:145987) |
| IUPAC Name |
|---|
| [(5S,5'S,6S,6'S)-1,1',6,6',9,9'-hexahydroxy-6,6'-dimethyl-8,8'-dioxo-5,5',6,6',7,7',8,8'-octahydro[2,2'-bianthracene]-5,5'-diyl]di(1R)ethane-1,1-diyl diacetate |
| Synonym | Source |
|---|---|
| julichrome Q6.6 | ChEBI |
| Citations |
|---|