EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H20N2O3 |
| Net Charge | 0 |
| Average Mass | 312.369 |
| Monoisotopic Mass | 312.14739 |
| SMILES | COc1cc(CCNCc2ccccc2O)c(OC)cc1C#N |
| InChI | InChI=1S/C18H20N2O3/c1-22-17-10-15(11-19)18(23-2)9-13(17)7-8-20-12-14-5-3-4-6-16(14)21/h3-6,9-10,20-21H,7-8,12H2,1-2H3 |
| InChIKey | VWEDZTZAXHMZIL-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | 5-hydroxytryptamine 2A receptor agonist An agonist at the 5-hydroxytryptamine 2A (5-HT2A) receptor. |
| Application: | hallucinogen Drugs capable of inducing illusions, hallucinations, delusions, paranoid ideations and other alterations of mood and thinking. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-{2-[(2-hydroxybenzyl)amino]ethyl}-2,5-dimethoxybenzonitrile (CHEBI:145979) has role 5-hydroxytryptamine 2A receptor agonist (CHEBI:145982) |
| 4-{2-[(2-hydroxybenzyl)amino]ethyl}-2,5-dimethoxybenzonitrile (CHEBI:145979) has role hallucinogen (CHEBI:35499) |
| 4-{2-[(2-hydroxybenzyl)amino]ethyl}-2,5-dimethoxybenzonitrile (CHEBI:145979) is a aromatic ether (CHEBI:35618) |
| 4-{2-[(2-hydroxybenzyl)amino]ethyl}-2,5-dimethoxybenzonitrile (CHEBI:145979) is a nitrile (CHEBI:18379) |
| 4-{2-[(2-hydroxybenzyl)amino]ethyl}-2,5-dimethoxybenzonitrile (CHEBI:145979) is a phenols (CHEBI:33853) |
| 4-{2-[(2-hydroxybenzyl)amino]ethyl}-2,5-dimethoxybenzonitrile (CHEBI:145979) is a secondary amino compound (CHEBI:50995) |
| 4-{2-[(2-hydroxybenzyl)amino]ethyl}-2,5-dimethoxybenzonitrile (CHEBI:145979) is conjugate base of 4-{2-[(2-hydroxybenzyl)amino]ethyl}-2,5-dimethoxybenzonitrile(1+) (CHEBI:145983) |
| Incoming Relation(s) |
| 4-{2-[(2-hydroxybenzyl)amino]ethyl}-2,5-dimethoxybenzonitrile(1+) (CHEBI:145983) is conjugate acid of 4-{2-[(2-hydroxybenzyl)amino]ethyl}-2,5-dimethoxybenzonitrile (CHEBI:145979) |
| IUPAC Name |
|---|
| 4-{2-[(2-hydroxybenzyl)amino]ethyl}-2,5-dimethoxybenzonitrile |
| Synonyms | Source |
|---|---|
| 4-[2-[(2-hydroxyphenyl)methylamino]ethyl]-2,5-dimethoxybenzonitrile | IUPAC |
| 25CN-NBOH | ChEBI |
| 2-([2-(4-cyano-2,5-dimethoxyphenyl)ethylamino]methyl)phenol | ChEBI |
| NBOH-2C-CN | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 25CN-NBOH | Wikipedia |
| Citations |
|---|